| Name | Pamabrom |
| Synonyms | PAMABROM Pamabrom PAMABROM,USP 2-azanyl-2-methyl-propan-1-ol 2-amino-2-methylpropanol 8-bromotheophyllinate 2-amino-2-methylpropan-1-ol,8-bromo-1,3-dimethyl-7H-purine-2,6-dione 8-bromo-1-methyl-2,6-dioxo-7H-purine-3-carboxylic acid (2-amino-2-methylpropyl) ester |
| CAS | 606-04-2 |
| EINECS | 210-103-4 |
| InChI | InChI=1/C7H7BrN4O2.C4H11NO/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14;1-4(2,5)3-6/h1-2H3,(H,9,10);6H,3,5H2,1-2H3 |
| Molecular Formula | C11H18BrN5O3 |
| Molar Mass | 348.2 |
| Melting Point | >300°C |
| Boling Point | 469.5°C at 760 mmHg |
| Flash Point | 237.7°C |
| Solubility | DMSO |
| Vapor Presure | 5.49E-09mmHg at 25°C |
| Appearance | neat |
| Color | White |
| Merck | 14,7000 |
| Storage Condition | Refrigerator |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| WGK Germany | 3 |
| Overview | Pamabrom, English name: pambrom, chemical name: 8-bromo-3, 7-dimethyl-1h-purin-2, 6-diketo-2-amino-2-methyl-1-propanol (8-bromotheophylline-2-amino-2-methyl-1-propanol), molecular formula: C11H18BrN5O3, molecular weight: 348.20. As a mild diuretic approved by the FDA, the combination of pyrimethamine maleate and acetaminophen can reduce swelling and water retention during menstruation by Head Pain, breast swelling, lower extremity edema and other premenstrual syndrome. At present, there are still some shortcomings in the production process of palmatine bromide, mainly because it is difficult to remove the palmatine bromide from the reaction vessel wall after crystallization, which brings a lot of inconvenience to the production, at the same time, it has a great influence on the purity of the product. |
| Application | , compound paracetamol and palmatine bromide tablets is a compound preparation for the treatment of dysmenorrhea and premenstrual syndrome. Paracetamol in the compound is a relatively safe antipyretic analgesic in clinic at present. The effectiveness and safety of the compound preparation have been confirmed by long-term clinical application abroad.|
| biological activity | pamabran is a diuretic that can relieve menstrual-related symptoms. Its active ingredient is 8-bromotheophylline. |