| Name | Pentacene |
| Synonyms | LT-S901 entacene PENTACENE Pentacene Pentacene (crude) BENZO[B]NAPHTHACENE Lin-Dibenzanthracene LIN-NAPHTHOANTHRACENE |
| CAS | 135-48-8 |
| EINECS | 205-193-7 |
| InChI | InChI=1/C22H14/c1-2-6-16-10-20-14-22-12-18-8-4-3-7-17(18)11-21(22)13-19(20)9-15(16)5-1/h1-14H |
| Molecular Formula | C22H14 |
| Molar Mass | 278.35 |
| Density | 1.1489 (estimate) |
| Melting Point | 372-374 °C (subl.) |
| Boling Point | 356.16°C (rough estimate) |
| Flash Point | 264.5°C |
| Water Solubility | insoluble |
| Solubility | Soluble in organic solvents. |
| Vapor Presure | 1.41E-10mmHg at 25°C |
| Appearance | Black powder |
| Color | Dark blue, purple, or black |
| Maximum wavelength(λmax) | ['577nm(Toluene)(lit.)'] |
| Merck | 14,7107 |
| BRN | 1912418 |
| Storage Condition | 0-6°C |
| Stability | Stable, but air and light sensitive. Incompatible with strong oxidizing agents. |
| Sensitive | Air & Light Sensitive |
| Refractive Index | 1.8120 (estimate) |
| MDL | MFCD00003710 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8-10-23 |
| TSCA | Yes |
| HS Code | 29029090 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Solvent | Pentacene is insoluble in most of the organic solvents. Trichlorobenzene is normally used to form solution at 60 - 120?°C [10] |
| Absorption | λmax?= 576 nm (in benzene) [11] |
| use | 1. prepare RFID tags (also known as electronic tags and long-distance radio frequency cards) as conductive plastics instead of traditional silicon crystal materials 2. manufacture organic solar cells, and pentacene can efficiently convert sunlight into electric energy |