| Name | Pseudothiohydantoin |
| Synonyms | Pseudothiohydantoin 2-Imino-4-thiazolidone 2-imino-4-thiazolidinon 2-amino-4(5h)-thiazolon 2-Imino-4-thiazolidinone 2-imino-4-thiazolidinone 2-imino-1,3-thiazol-4-one 2-Imino-2-thiazolin-4-one 4(5H)-Thiazolone, 2-imino- 2-Thiazolin-4-one, 2-imino- 2-amino-1,3-thiazol-4(5H)-one 2-Imino-1,3-thiazolidin-4-one |
| CAS | 556-90-1 |
| EINECS | 209-145-6 |
| InChI | InChI=1/C3H4N2OS/c4-3-5-2(6)1-7-3/h1H2,(H2,4,5,6) |
| Molecular Formula | C3H4N2OS |
| Molar Mass | 116.14 |
| Density | 1.637 g/cm3 |
| Melting Point | 249°C (dec.)(lit.) |
| Boling Point | 253.5±23.0 °C(Predicted) |
| Flash Point | 107.1°C |
| Vapor Presure | 0.0182mmHg at 25°C |
| Appearance | solid |
| pKa | 0.54±0.20(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.6550 (estimate) |
| MDL | MFCD00003186 |
| Hazard Symbols | Xi - Irritant![]() |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | XJ6276000 |
| TSCA | Yes |
| HS Code | 29349990 |
| Hazard Class | IRRITANT |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |