| Name | R(-)-2-hexanol |
| Synonyms | (R)-2-Hexanol (R)-2-HEXANOL R(-)-2-hexanol (R)-Hexan-2-ol (2R)-2-Hexanol (2R)-Hexan-2-ol (2R)-hexan-2-ol (R)-(-)-2-HEXANOL (R)-(-)-2-Hexanol RARECHEM AK HZ 0015 (R)-(-)-2-HYDROXYHEXANE |
| CAS | 26549-24-6 |
| InChI | InChI=1/C6H14O/c1-3-4-5-6(2)7/h6-7H,3-5H2,1-2H3/t6-/m1/s1 |
| Molecular Formula | C6H14O |
| Molar Mass | 102.17 |
| Density | 0.814g/mLat 20°C(lit.) |
| Melting Point | -48.42°C (estimate) |
| Boling Point | 137-138°C(lit.) |
| Flash Point | 124°F |
| Vapor Presure | 2.63mmHg at 25°C |
| pKa | 15.31±0.20(Predicted) |
| Refractive Index | n20/D 1.414(lit.) |
| Risk Codes | 10 - Flammable |
| UN IDs | UN 2282 3/PG 3 |
| WGK Germany | 3 |
| application | R(-)-2-hexanol can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. |