| Name | Ramiprilat |
| Synonyms | Ramiprilat RAMIPRILAT HOE 498 Diacid RAMIPRILAT HYDRATE Ramiprilat, ammonium salt Ramipril EP Imp E (acid) Ramipril EP Impurity E (Ramiprilat) (2S,3aS,6aS)-1-[(2S)-2-[[(1S)-1-Carboxy-3-phenylpropyl]amino]-1-oxopropyl]octahydrocyclopenta[b]pyrrole-2-carboxylic Acid (2S,3aS,6aS)-1-[(2S)-2-{[(1S)-1-Carboxy-3-phenylpropyl]amino}propanoyl]octahydrocyclopenta[b]pyrrole-2-carboxylic acid (non-preferred name) |
| CAS | 87269-97-4 |
| EINECS | 258-696-9 |
| InChI | InChI=1/C21H28N2O5/c1-13(22-16(20(25)26)11-10-14-6-3-2-4-7-14)19(24)23-17-9-5-8-15(17)12-18(23)21(27)28/h2-4,6-7,13,15-18,22H,5,8-12H2,1H3,(H,25,26)(H,27,28)/t13-,15-,16-,17-,18-/m0/s1 |
| Molecular Formula | C21H28N2O5 |
| Molar Mass | 388.46 |
| Density | 1.273±0.06 g/cm3(Predicted) |
| Melting Point | 139-141°C |
| Boling Point | 632.2±55.0 °C(Predicted) |
| Flash Point | 336.2°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 7.47E-17mmHg at 25°C |
| Appearance | Solid |
| Color | White to Pale Yellow |
| pKa | 2.20±0.10(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Stability | Hygroscopic |
| Refractive Index | 1.583 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/38 - Irritating to eyes and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |