| Name | Sparteine |
| Synonyms | Spartine Spartein Sparteine Lupinidin (-)-Sparteine (-)-SPARTEINE (7alpha)-sparteine (7alpha,9alpha)-sparteine MINUS-SPARTEINE FREE BASE |
| CAS | 90-39-1 |
| EINECS | 201-988-8 |
| InChI | InChI=1/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15+/m1/s1 |
| Molecular Formula | C15H26N2 |
| Molar Mass | 234.38 |
| Density | 1.02g/mLat 25°C(lit.) |
| Melting Point | 30.5°C |
| Boling Point | 137-138°C1mm Hg(lit.) |
| Specific Rotation(α) | D21 -16.4° (c = 10 in abs alc) |
| Flash Point | >230°F |
| Water Solubility | 3.04g/L(25 ºC) |
| Solubility | Water solubility 3.04g/L(25°C) |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | liquid |
| Color | Light Yellow to Yellow |
| Merck | 14,8737 |
| BRN | 82447 |
| pKa | 2.24, 9.46(at 20℃) |
| Storage Condition | 2-8°C |
| Sensitive | Sensitive to air |
| Refractive Index | n20/D 1.528(lit.) |
| MDL | MFCD00069653 |
| In vitro study | (-)-Sparteine is a natural alkaloid. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | 36 - Wear suitable protective clothing. |
| UN IDs | 3140 |
| WGK Germany | 3 |
| RTECS | WG5950000 |
| Hazard Class | 6.1(b) |
| Packing Group | III |
| biological activity | (-)-Sparteine is a natural alkaloid compound isolated from legumes. |
| in vitro study | (-)-Sparteine is a natural alkaloid. |
| Use | Actinine is found in yellow and black lupine, and it is also found in other lupine plants and cycad and geranium plants. In therapy, it is used as an oxytocin. It has the effect of exciting the uterus; it has the performance of inducing labor; it has the effect of anti-arrhythmia, which can reduce myocardial stress and conductivity, slow down the heart rate, and inhibit the contractility of the heart. |