| Name | Tofisopam |
| Synonyms | Tosopam TOFISOPAM tofizopam Tofisopam TOFISOPAM 22345-47-7 1-(3,4-Dimethoxyphenyl)-5-ethyl-7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepine 1-(3,4-Dimethoxyphenyl)-4-methyl-5-ethyl-7,8-dimethoxy-5H-2,3-benzodiazepine 7,8-DIMETHOXY-1-(3,4-DIMETHOXYPHENYL)-5-ETHYL-4-METHYL-5H-2,3-BENZODIAZEPINE 1-(3,4-Dimethoxyphenyl)-5-ethyl-7,8-dimethoxy-4-methyl-5H-benzo[d][1,2]diazepine 5H-2,3-Benzodiazepine, 1-(3,4-dimethoxyphenyl)-5-ethyl-7,8-dimethoxy-4-methyl- (8CI, 9CI) |
| CAS | 22345-47-7 |
| EINECS | 244-922-3 |
| InChI | InChI=1/C22H26N2O4/c1-7-15-13(2)23-24-22(14-8-9-18(25-3)19(10-14)26-4)17-12-21(28-6)20(27-5)11-16(15)17/h8-12,15H,7H2,1-6H3 |
| Molecular Formula | C22H26N2O4 |
| Molar Mass | 382.45 |
| Density | 1.2098 (rough estimate) |
| Melting Point | 155-159°C |
| Boling Point | 509.61°C (rough estimate) |
| Flash Point | 195.2°C |
| Solubility | DMSO: ~14mg/mL |
| Vapor Presure | 7.13E-09mmHg at 25°C |
| Appearance | solid |
| Color | white |
| Maximum wavelength(λmax) | ['310nm(MeOH)(lit.)'] |
| Merck | 14,9503 |
| pKa | 7.29±0.40(Predicted) |
| Refractive Index | 1.6500 (estimate) |
| Risk Codes | R22 - Harmful if swallowed R50 - Very Toxic to aquatic organisms |
| Safety Description | S60 - This material and its container must be disposed of as hazardous waste. S61 - Avoid release to the environment. Refer to special instructions / safety data sheets. |
| UN IDs | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DE9540000 |
| Hazard Class | 6.1(b) |
| Packing Group | III |