Tributylamine
Tributylamine - Names and Identifiers
| Name | Tributylamine |
| Synonyms | TBA TNBA (n-C4H9)3N TRIBUTYLAMINE Tributylamine TRI-N-BUTYLAMINE Tri-n-butylamine Tri-n-Butyl amine N,N-dibutylbutan-1-amine N,N-DIBUTYL-1-BUTANAMINE N,N-Dibutyl-1-butanamine 1-Butanamine,N,N-dibutyl- N,N-dibutylbutan-1-aminium 1-Butanamine, N,N-dibutyl- |
| CAS | 102-82-9 |
| EINECS | 203-058-7 |
| InChI | InChI=1/C12H27N/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3/p+1 |
Tributylamine - Physico-chemical Properties
| Molecular Formula | C12H27N |
| Molar Mass | 185.35 |
| Density | 0.778g/mLat 25°C(lit.) |
| Melting Point | −70°C(lit.) |
| Boling Point | 216°C(lit.) |
| Flash Point | 146°F |
| Water Solubility | 0.386 g/L (25 ºC) |
| Solubility | sparingly soluble in water; soluble in most organic solvents; solublein acetone and benzene; very soluble in alcohol and ether |
| Vapor Presure | 0.3 mm Hg ( 20 °C) |
| Vapor Density | 6.38 (vs air) |
| Appearance | Liquid |
| Color | Clear |
| Merck | 14,9618 |
| BRN | 1698872 |
| pKa | 9.99±0.50(Predicted) |
| Storage Condition | Store at RT. |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents, strong acids. Hygroscopic. |
| Sensitive | Hygroscopic |
| Refractive Index | n20/D 1.428(lit.) |
| Physical and Chemical Properties | density 0.778 melting point -70°C boiling point 215°C refractive index 1.4273-1.4293 flash point 70°C water-soluble 0.386g/L (25°C) |
| Use | Used in petroleum additives, solvents, pharmaceutical intermediates, pesticides, emulsifiers, plastic plasticizers, mineral flotation agents and surfactants |
Tributylamine - Reference Information
| LogP | 3.34 at 25℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | raw materials for fine chemicals such as perfluorotributylamine, tetrabutylammonium chloride, tetrabutylammonium bromide, etc. used as extractants and solvents used in petroleum additives, solvents, pharmaceutical intermediates, pesticides, emulsifiers, plastic plasticizers, mineral flotation agents and surfactants, etc. production of pharmaceuticals, pesticides, dyes, mineral flotation agents, emulsifiers and intermediates of fine chemicals. |
| production method | butanol, ammonia, and hydrogen are passed into a reaction tower filled with a copper-nickel acidic clay catalyst according to the ratio, and the reaction is at about 200 ℃, The reaction gas is condensed to obtain a mixture containing monobutylamine, dibutylamine, and tributylamine, and the three products are separated by rectification. |
| category | corroded articles |
| toxicity classification | poisoning |
| acute toxicity | oral-rat LD50: 114 mg/kg; Oral-mouse LD50: 114 mg/kg |
| explosive hazard characteristics | blastable when mixed with air |
| flammability hazard characteristics | flammability |
| storage and transportation characteristics | warehouse ventilation and low temperature drying; separate from acid and oxidant |
| fire extinguishing agent | dry powder, carbon dioxide, alcohol-resistant foam |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |
Last Update：2024-04-09 19:05:09
