| Name | trimetazidine |
| Synonyms | AKOS B006602 trimetazidine TRIMETAZIDINE TRIMETAZIDINE HCL ART-CHEM-BB B006602 ART-CHEM-BB B014361 TIMTEC-BB SBB007020 1-(2,3,4-trimethoxybenzyl)piperazine 1-(2,3,4-TRIMETHOXY-BENZYL)-PIPERAZINE 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| CAS | 5011-34-7 |
| EINECS | 225-690-2 |
| InChI | InChI=1/C14H22N2O3/c1-17-12-5-4-11(13(18-2)14(12)19-3)10-16-8-6-15-7-9-16/h4-5,15H,6-10H2,1-3H3 |
| Molecular Formula | C14H22N2O3 |
| Molar Mass | 266.34 |
| Density | 1.092±0.06 g/cm3(Predicted) |
| Boling Point | bp2 200-205° |
| Solubility | Chlorofrom (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.003Pa at 25℃ |
| Appearance | Solid |
| Color | Colourless to Pale Yellow Gel to |
| pKa | 9.07±0.10(Predicted) |
| Storage Condition | Hygroscopic, Refrigerator, Under inert atmosphere |
| Stability | Hygroscopic |
| Hazard Symbols | Xi - Irritant![]() |
| Hazard Class | IRRITANT |