| Name | Tris(4-chlorophenyl)phosphine |
| Synonyms | TRI(P-CHLOROPHENYL)PHOSPHINE TRI(4-CHLOROPHENYL)PHOSPHINE tris(4-chlorophenyl)phosphane TRIS(4-CHLOROPHENYL)PHOSPHINE TRIS(P-CHLOROPHENYL)PHOSPHINE Tris(4-chlorophenyl)phosphine Phosphine, tris(p-chlorophenyl)- Phosphine, tris(4-chlorophenyl)- 1,1-dimethyl-3-(5-nitro-1,2-benzothiazol-3-yl)urea |
| CAS | 1159-54-2 |
| EINECS | 214-596-7 |
| InChI | InChI=1/C18H12Cl3P/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H |
| Molecular Formula | C18H12Cl3P |
| Molar Mass | 365.62 |
| Melting Point | 100-103 °C (lit.) |
| Boling Point | 427.6±40.0 °C(Predicted) |
| Flash Point | 212.4°C |
| Vapor Presure | 4.04E-07mmHg at 25°C |
| Appearance | White crystalline powder |
| Color | white |
| BRN | 751458 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Air Sensitive |
| MDL | MFCD00013639 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | 3278 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29310099 |
| Packing Group | III |