| Name | Tropinone |
| Synonyms | Tropinone NSC 118012 3-Tropanone Tropanone (6CI) Tropinone (7CI) TIMTEC-BB SBB006924 1αH,5αH-Tropan-3-one 1αH,5αH-Tropan-3-one (8CI) 8-Methyl-8-azabicyclo[3.2.1]octan-3-one 8-Azabicyclo[3.2.1]octan-3-one, 8-methyl- (1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-one (1R,5S)-8-methyl-3-oxo-8-azoniabicyclo[3.2.1]octane 8-Methyl-2-({3-oxo-8-azabicyclo[3.2.1]octan-8-yl}Methyl)-8-azabicyclo[3.2.1]octan-3-one |
| CAS | 532-24-1 |
| EINECS | 208-530-6 |
| InChI | InChI=1/C8H13NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-7H,2-5H2,1H3/p+1/t6-,7+ |
| InChIKey | QQXLDOJGLXJCSE-KNVOCYPGSA-N |
| Molecular Formula | C8H13NO |
| Molar Mass | 139.19 |
| Density | 1.0268 (rough estimate) |
| Melting Point | 40-44°C(lit.) |
| Boling Point | 113°C25mm Hg(lit.) |
| Flash Point | 194°F |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.135mmHg at 25°C |
| Appearance | White to bright yellow crystals |
| Color | brown |
| BRN | 2329 |
| pKa | 8.93±0.20(Predicted) |
| PH | 8 (18g/l, H2O, 20℃) |
| Storage Condition | Inert atmosphere,2-8°C |
| Refractive Index | 1.4598 (estimate) |
| MDL | MFCD00005549 |
| Physical and Chemical Properties | Needle-like crystals (gasoline). Melting point 42 ℃, boiling point 125 ℃/5.3kPa,113 ℃/3.3kPa,103-104 ℃ /1.7kPa, flash point 90 ℃. |
| Use | Used as a pharmaceutical Intermediate |
| Risk Codes | R34 - Causes burns R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S22 - Do not breathe dust. |
| UN IDs | 1544 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29399990 |
| Hazard Class | 6.1 |
| Packing Group | III |