| Name | chloroxynil |
| Synonyms | chloroxynil CHLOROXYNIL 4-Cyano-2,6-dichlorophenol 3,5-Dichloro-4-hydroxyben... 3,5-DICHLORO-4-HYDROXYBENZONITRILE 3,5-dichloro-4-hydroxybenzonitrile Benzonitrile, 3,5-dichloro-4-hydroxy- 3,5-dichloro-4-hydroxy-benzenecarbonitrile |
| CAS | 1891-95-8 |
| EINECS | 217-572-4 |
| InChI | InChI=1/C7H3Cl2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H |
| Molecular Formula | C7H3Cl2NO |
| Molar Mass | 188.01 |
| Density | 1.57±0.1 g/cm3(Predicted) |
| Melting Point | 138-142°C |
| Boling Point | 256.6±40.0 °C(Predicted) |
| Flash Point | 109°C |
| Water Solubility | Slightly soluble in water. |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.00947mmHg at 25°C |
| Appearance | neat |
| Color | White to Off-White |
| BRN | 1949990 |
| pKa | 4.91±0.23(Predicted) |
| Storage Condition | -20°C Freezer, Under inert atmosphere |
| Refractive Index | 1.628 |
| MDL | MFCD00002177 |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | R23/24/25 - Toxic by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S2 - Keep out of the reach of children. S13 - Keep away from food, drink and animal foodstuffs. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN3439 |
| WGK Germany | 3 |
| Hazard Class | 6.1 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |