| Name | Diclofenac |
| Synonyms | Diclofenac Diciofenac Diclofenac Acid (N-1-(2,6-DICHLOROPHENYL) -2-INDOLIN-2-ONE (o-(2,6-dichloroanilino)phenyl)-acetic acid 2-((2,6-dichlorophenyl)amino)benzeneacetic acid 1-(2,6-DICHLOROPHENYL)-1,3-DIHYDRO-INDOLE-2-ONE 2-[[2,6-Dichlorophenyl] amino] benzeneacetic acid 1-(2,6-dichlorophenyl)-1,3-dihydro-2H-indol-2-one |
| CAS | 15307-86-5 |
| EINECS | 239-348-5 |
| InChI | InChI=1/C14H9Cl2NO/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(17)18/h1-7H,8H2 |
| InChIKey | DCOPUUMXTXDBNB-UHFFFAOYSA-N |
| Molecular Formula | C14H11Cl2NO2 |
| Molar Mass | 296.15 |
| Density | 1.431±0.06 g/cm3(Predicted) |
| Melting Point | 156-158° |
| Boling Point | 412.0±45.0 °C(Predicted) |
| Flash Point | 249.3°C |
| Water Solubility | 1.278mg/L(30 ºC) |
| Solubility | soluble in Methanol |
| Vapor Presure | 1.07E-09mmHg at 25°C |
| Appearance | White to pale yellow crystalline powder |
| Color | White to Almost white |
| Merck | 14,3081 |
| pKa | pKa 4 (Uncertain) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.66 |
| Use | Used as an anti-inflammatory analgesic |
| UN IDs | 3249 |
| RTECS | AG6310000 |
| Hazard Class | 6.1(b) |
| Packing Group | III |
| Reference Show more | 1. [IF=2.193] Zhang Tingting et al."Quantitation of Diclofenac, Tolbutamide, and Warfarin as Typical CYP2C9 Substrates in Rat Plasma by UPLC-MS/MS and Its Application to Evaluate Linderane-Mediated Herb-Drug Interactions."J Anal Methods Chem. 2022;2022:1900037 |