| Name | dihydroethidium |
| Synonyms | PD-MY 003 PD-MY 003 HYDROETHIDINE dihydroethidium (DIHYDROETHIDIUM BROMIDE) DIHYDROETHIDIUM, FOR FLUORESCENCE* 5-ethyl-6-phenyl-5,6-dihydrophenanthridine-3,8-diaMine 3,8-Phenanthridinediamine,5-ethyl-5,6-dihydro-6-phenyl- 2,7-Diamino-10-ethyl-9-phenyl-9,10-dihydrophenanthridine 3,8-Diamino-5,6-dihydro-5-ethyl-6-phenylphenanthridine Hydroethidine |
| CAS | 104821-25-2 |
| InChI | InChI=1/C21H21N3/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14/h3-13,21H,2,22-23H2,1H3 |
| Molecular Formula | C21H21N3 |
| Molar Mass | 315.41 |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| Boling Point | 580.4±50.0 °C(Predicted) |
| Flash Point | 299.5°C |
| Solubility | acetonitrile: soluble |
| Vapor Presure | 1.83E-13mmHg at 25°C |
| Appearance | Red powder |
| Color | Pink to dark brown |
| Maximum wavelength(λmax) | ['355 nm'] |
| BRN | 5107482 |
| pKa | 5.30±0.40(Predicted) |
| Storage Condition | −20°C |
| Sensitive | Air `sensitive`, light `sensitive` |
| Refractive Index | 1.68 |
| MDL | MFCD00077335 |
| Use | Redox indicator that fluoresces blue until it is oxidized to pyridinium (ethidium). |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8-10 |
| HS Code | 29339900 |
| biological field application | Apoptosis say; generating and detecting reactive oxygen species (ROS); detecting nucleic acids,cells; measuring respiratory burst; superoxide indicator; viability say |
| biological activity | Dihydroethidium (DHE, HE, Hydroethidine, PD-MY 003) is a cell-permeable blue fluorescent probe used to detect intracellular superoxide radical anion. |
| use | redox indicator, fluorescent blue until oxidized to pyridinium (ethidium). |