| Name | ethylchlorofluoroacetate |
| Synonyms | ethylchlorofluoroacetate Ethyl chlorofluoroacetate ETHYL CHLOROFLUOROACETATE chlorofluoro-aceticaciethylester ethyl (2R)-chloro(fluoro)ethanoate ethyl (2S)-chloro(fluoro)ethanoate Chlorofluoroacetic acid ethyl ester Fluorochloroacetic acid ethyl ester CHLOROFLUOROACETIC ACID ETHYL ESTER 2-Chloro-2-fluoroacetic acid ethyl ester |
| CAS | 401-56-9 |
| EINECS | 206-930-5 |
| InChI | InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
| InChIKey | WUHVJSONZHSDFC-UHFFFAOYSA-N |
| Molecular Formula | C4H6ClFO2 |
| Molar Mass | 140.54 |
| Density | 1.212 g/mL at 25 °C (lit.) |
| Boling Point | 133 °C (lit.) |
| Flash Point | 125°F |
| Vapor Presure | 10.4mmHg at 25°C |
| Appearance | clear liquid |
| Specific Gravity | 1.225 |
| Color | Colorless to Almost colorless |
| BRN | 1748679 |
| Refractive Index | n20/D 1.396(lit.) |
| Risk Codes | R10 - Flammable R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29159000 |
| Hazard Note | Flammable |
| Hazard Class | 3 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |