| Name | pebulate |
| Synonyms | PEBC R-2061 TILLAM PEBULAT pebulate PEBULATE TILLAM(R) S-PROPYL N-BUTYLTHIOL-CARBAMATE S-propyl butyl(ethyl)thiocarbamate S-propyl butyl(ethyl)carbamothioate S-PROPYL-N-BUTYL-N-ETHYLTHIOCARBAMATE |
| CAS | 1114-71-2 |
| EINECS | 214-215-4 |
| InChI | InChI=1/C10H21NOS/c1-4-7-8-11(6-3)10(12)13-9-5-2/h4-9H2,1-3H3 |
| Molecular Formula | C10H21NOS |
| Molar Mass | 203.34 |
| Density | 0.9458 g/cm3 (30 ºC) |
| Boling Point | 142℃ |
| Flash Point | 118.8°C |
| Water Solubility | 92mg/L(21 ºC) |
| Vapor Presure | 0.00596mmHg at 25°C |
| Appearance | Liquid |
| Color | Amber |
| BRN | 1933846 |
| pKa | -1.19±0.70(Predicted) |
| Storage Condition | 0-6°C |
| Refractive Index | 1.4752 (589.3 nm 30℃ |
| Risk Codes | R22 - Harmful if swallowed R51/53 - Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. |
| Safety Description | S23 - Do not breathe vapour. S61 - Avoid release to the environment. Refer to special instructions / safety data sheets. |
| UN IDs | UN3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | EZ0400000 |
| HS Code | 29302000 |
| Toxicity | LD50 orally in rats: 1.12 g/kg (Bailey, White) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | control annual gramineous weeds, sedge and broadleaf weeds in sugar beet, tomato, tobacco and other crops |
| category | pesticide |
| toxicity classification | poisoning |
| acute toxicity | oral-rat LD50: 921 mg/kg; Oral-mouse LD50: 1652 mg/kg |
| flammability hazard characteristics | Combustion produces toxic sulfur oxides and nitrogen oxide gases |
| storage and transportation characteristics | warehouse ventilation and low temperature drying; separate from food raw materials storage and transportation |
| fire extinguishing agent | dry powder, foam, sand |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |