| Name | pyrithioxine |
| Synonyms | bonol PYRITINOL pyritinol biocefalin PYRITHIOXIN pyrithioxine PYRITHIOXINE 3,3'-(dithiodimethylene)bis(5-hydroxy-6-methyl-4-pyridinemethano bis(5-hydroxy-4-hydroxymethyl-6-methyl-3-pyridylmethyl) disulphide 3,3'-(dithiobis(methylene))bis(5-hydroxy-6-methyl-4-pyridinemethano 3,3'-(dithiobis(methylene))bis(5-hydroxy-6-methyl-4-pyridinemethanol) |
| CAS | 1098-97-1 |
| EINECS | 214-150-1 |
| InChI | InChI=1/C16H20N2O4S2/c1-9-15(21)13(5-19)11(3-17-9)7-23-24-8-12-4-18-10(2)16(22)14(12)6-20/h3-4,19-22H,5-8H2,1-2H3 |
| Molecular Formula | C16H20N2O4S2 |
| Molar Mass | 368.47 |
| Density | 1.448±0.06 g/cm3(Predicted) |
| Melting Point | 218-220° |
| Boling Point | 742.8±60.0 °C(Predicted) |
| Appearance | neat |
| Color | White to Light yellow to Light orange |
| Merck | 14,7996 |
| pKa | 9.31±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Use | Used as a pharmaceutical Intermediate |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 2 |
| RTECS | UT4836666 |
| biological activity | Pyrithioxin is a neurodynamic compound that promotes the metabolism of glucose and amino acids in the brain, improves systemic assimilation, increases carotid blood flow, and improves cerebral blood flow. |
| Use | Used as a pharmaceutical intermediate |
| category | toxic substances |
| toxicity classification | low toxicity |
| acute toxicity | oral-rat LD50: 6000 mg/kg; Oral-mouse LD50: 5786 mg/kg |
| flammability hazard characteristics | thermal decomposition discharges toxic nitrogen oxides, sulfur oxides, and hydrogen chloride gas |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | water, dry powder, dry sand, carbon dioxide, foam, 1211 fire extinguishing agent |