| Name | Quinidine |
| Synonyms | B-QUININE Quinidine QUINIDINE CONQUININE CONCHININE (+)-Quindine (+)-QUINDINE (+)-QUINIDINE Quinidine free base (9S)-6'-methoxycinchonan-9-ol (8R,9S)-6'-Methoxycinchonan-9-ol (9S)-6'-methoxycinchonan-1-ium-9-ol (4beta,9S)-9-hydroxy-6'-methoxycinchonan-1-ium (8alpha,9S)-9-hydroxy-6'-methoxycinchonan-1-ium (4beta,8alpha,9S)-9-hydroxy-6'-methoxycinchonan-1-ium 6-METHOXY-A-(5-VINYL-2-QUINUCLIDINYL)-4-QUINOLINE-METHANOL |
| CAS | 56-54-2 |
| EINECS | 200-279-0 |
| InChI | InChI=1/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/p+1/t13-,14-,19-,20-/m0/s1 |
| Molecular Formula | C20H24N2O2 |
| Molar Mass | 324.42 |
| Density | 1.1294 (rough estimate) |
| Melting Point | 168-172°C(lit.) |
| Boling Point | 462.75°C (rough estimate) |
| Specific Rotation(α) | 256 º (c=1, EtOH) |
| Flash Point | 253.699°C |
| Water Solubility | 0.05 g/100 mL (20 ºC) |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | White Crystal |
| Color | White to off-white |
| Merck | 14,8060 |
| BRN | 91866 |
| pKa | 5.4, 10.0(at 20℃) |
| Storage Condition | Keep in dark place,Sealed in dry,2-8°C |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Sensitive | Light Sensitive |
| Refractive Index | 1.5700 (estimate) |
| MDL | MFCD00135581 |
| Use | Class IA antiarrhythmic drug; potassium channel blocker; also used as chiral catalyst. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S36 - Wear suitable protective clothing. S22 - Do not breathe dust. |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | VA4725000 |
| FLUKA BRAND F CODES | 8 |
| TSCA | Yes |
| HS Code | 29392000 |
| Hazard Class | 6.1(b) |
| Packing Group | III |
| Toxicity | LD50 in rats (mg/kg): 30 i.v., 263 orally (Dietmann) |
| Reference Show more | 1. Wang Chengyu, Li Dengke, Quan Zhengyang, Hu Ying also, Sun Zhenxiao. Study on hepatotoxicity and related components of Polygonum multiflorum based on cytochrome oxidase CYP2D6 [J]. Pharmacovigilance in China, 2021,18(03):220-227 239. 2. Chen Rui, Zhou Wei, Zhang Li, Zhu Gaogao, Huang Jing, Tang Lei. In vitro inhibition of five common Cytochrome P_(450) enzymes in human liver microsomes by bevacizumab acid A [J]. China Pharmacy, 2021,32(02):195-200. 3. Hu et al Ying-huan [IF = 3.5]. "Inhibition of CYP3A4 senses aloe-emodin induced hepatocyte injury." Toxicol In Vitro. 2021 Dec;:105276 |