| Name | sauchinone |
| Synonyms | AI3 00896 sauchinone SAUCHINONE 5H-benzo[kl][1,3]dioxolo[4,5-b]-1,3-dioxolo[4,5-g]xanthen-5-one, 5a,6,7,8,8a,14b-hexahydro-7,8-dimethyl-, (5aR,7R,8S,8aR,14aS,14bR)- |
| CAS | 177931-17-8 |
| InChI | InChI=1/C20H20O6/c1-9-3-11-13(21)5-17-20(25-8-24-17)19(11)18(10(9)2)12-4-15-16(23-7-22-15)6-14(12)26-20/h4-6,9-11,18-19H,3,7-8H2,1-2H3/t9-,10+,11+,18+,19+,20+/m1/s1 |
| Molecular Formula | C20H20O6 |
| Molar Mass | 356.37 |
| Density | 1.43±0.1 g/cm3 (20 ºC 760 Torr) |
| Melting Point | 224-226℃ |
| Boling Point | 498.1±45.0 °C(Predicted) |
| Specific Rotation(α) | (c, 0.02 in CHCl3)+97.8;(c, 1 in CHCl3)-140 |
| Solubility | Soluble in solvents such as acetone and ethyl acetate, insoluble in water. |
| Appearance | White needle crystal |
| Color | white to beige |
| Storage Condition | 2-8°C |
| MDL | MFCD08702698 |
| Physical and Chemical Properties | Yellow crystalline powder, soluble in methanol, ethyl acetate, from saururus chinensis. |
| In vitro study | Sauchinone (1, 3, 10, 30μm; 6 hours) inhibits LPS-inducible increase in the iNOS mRNA in Raw264.7 cells. Sauchinone at the concentrations of 3 and 30μminhibits TNF-αproduction in LPS-treated cells by 40 and 50%, respectively. |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Biological activity | Sauchinone is a diastereomeric lignan, obtained from Saururus chinensis. Sauchinone inhibited LPS-induced expression of iNOS,TNF-α, and COX-2 by inhibiting I-κBα phosphorylation and p65 nuclear translocation. Sauchinone has anti-inflammatory and antioxidant activities. |
| use | sanbaicao ketone has anti-inflammatory and antibacterial effects. used for content determination/identification/pharmacological experiment, etc. Pharmacological effect: mainly has the effect of clearing away heat and detoxification, diuresis and detumescence. |