| Name | tetramethylammonium triacetoxy borohydride |
| Synonyms | triacetoxyboranuide Tetramethyltriammonium TETRAMETHYLAMMONIUM TRIACETOXYBOROHYDRIDE tetramethylammonium triacetoxy borohydride |
| CAS | 109704-53-2 |
| InChI | InChI=1/C6H10BO6.C4H12N/c1-4(8)11-7(12-5(2)9)13-6(3)10;1-5(2,3)4/h7H,1-3H3;1-4H3/q-1;+1 |
| InChIKey | LCFZZOGKVOTFPU-UHFFFAOYSA-N |
| Molecular Formula | C10H22BNO6 |
| Molar Mass | 263.1 |
| Melting Point | 93-98°C(lit.) |
| BRN | 8238791 |
| Storage Condition | 2-8°C |
| Sensitive | 7: reacts slowly with moisture/water |
| MDL | MFCD00012196 |
| Risk Codes | R15 - Contact with water liberates extremely flammable gases R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S43 - In case of fire use ... (there follows the type of fire-fighting equipment to be used.) |
| UN IDs | UN 2813 4.3/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 3-10-21 |
| HS Code | 29239000 |
| Hazard Class | 4.3 |
| Packing Group | III |