| Name | tridecanal |
| Synonyms | TRIDECANAL tridecanal N-TRIDECANAL 1-Tridecanal Tridecanaldehyde TRIDECYLALDEHYDE Tridecane aldehyde N-TRIDECANALDEHYDE TIMTEC-BB SBB006533 N-TRIDECYL ALDEHYDE 4-methyl-N'-(4-methylbenzoyl)benzohydrazide |
| CAS | 10486-19-8 |
| EINECS | 234-004-0 |
| InChI | InChI=1/C16H16N2O2/c1-11-3-7-13(8-4-11)15(19)17-18-16(20)14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H,17,19)(H,18,20) |
| Molecular Formula | C13H26O |
| Molar Mass | 198.34 |
| Density | 0.835g/mLat 25°C(lit.) |
| Melting Point | 15°C |
| Boling Point | 132-136°C8mm Hg(lit.) |
| Flash Point | >230°F |
| Water Solubility | Insoluble in water |
| Vapor Presure | 3.25E-11mmHg at 25°C |
| Appearance | Liquid |
| Color | White or Colorless to Light yellow |
| Storage Condition | 2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.437(lit.) |
| MDL | MFCD00007018 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| TSCA | Yes |
| FEMA | 4335 | TRIDECANAL |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |