| Name | tris(pentafluorophenyl)phosphine |
| Synonyms | Tris(perfluorophenyl)phosphine tris(pentafluorophenyl)phosphine tris(pentafluorophenyl)phosphane TRIS(PENTAFLUOROPHENYL)PHOSPHINE Phosphine, tris(pentafluorophenyl)- tris(2,3,4,5,6-pentafluorophenyl)-Phosphine |
| CAS | 1259-35-4 |
| EINECS | 215-021-2 |
| InChI | InChI=1/C18F15P/c19-1-4(22)10(28)16(11(29)5(1)23)34(17-12(30)6(24)2(20)7(25)13(17)31)18-14(32)8(26)3(21)9(27)15(18)33 |
| InChIKey | FQLSDFNKTNBQLC-UHFFFAOYSA-N |
| Molecular Formula | C18F15P |
| Molar Mass | 532.14 |
| Melting Point | 108-110 °C (lit.) |
| Boling Point | 343.4±42.0 °C(Predicted) |
| Flash Point | 161.5°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.00014mmHg at 25°C |
| Appearance | White to bright yellow crystals |
| Color | Clear colorless to yellow |
| BRN | 773243 |
| Storage Condition | Inert atmosphere,Room Temperature |
| MDL | MFCD00079654 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10 |
| TSCA | No |
| HS Code | 29319019 |
| Hazard Note | Irritant |
| Uses | Tris (pentafluorophenyl) phosphine is an organic phosphine compound and can be used as a phosphine ligand. |