| Name | Uridine |
| Synonyms | UR URD Uridine uridinato URACIL RIBOSIDE URACIL-3-RIBOSIDE TIMTEC-BB SBB000838 1-D-Ribofuranosyluracil 1-beta-d-ribofuranosyl-uraci URACIL-1-BETA-D-RIBOFURANOSIDE 1-beta-L-xylofuranosylpyrimidine-2,4(1H,3H)-dione |
| CAS | 58-96-8 |
| EINECS | 200-407-5 |
| InChI | InChI=1/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6+,7-,8-/m0/s1 |
| Molecular Formula | C9H12N2O6 |
| Molar Mass | 244.2 |
| Density | 1.674g/cm3 |
| Melting Point | 165-170℃ |
| Boling Point | 387.12°C (rough estimate) |
| Specific Rotation(α) | 9 ° (C=2, H2O);8.4 °(C=2,WATER) |
| Water Solubility | H2O: 50 mg/mL |
| Solubility | Soluble in water, slightly soluble in dilute alcohol, insoluble in absolute ethanol. |
| Appearance | White or white-like crystalline powder |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.643 |
| MDL | MFCD00006526 |
| Physical and Chemical Properties | Melting point 165-170°C specific rotation 8.4 ° (c = 2,water) |
| Use | For the manufacture of fluorouracil deoxynucleosides, iodine and other anti-tumor drugs |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
This product can be used for giant red blood cell anemia, can also be combined with other nucleosides, bases for the treatment of liver, cerebrovascular and cardiovascular diseases.
usage and oral dose, 2mg each time.
| dangerous goods mark | Xi |
| hazard category code | 36/37/38 |
| safety instructions | 24/25-36-26 |
| WGK Germany | 3 |
| RTECS number | YR1450000 |
| F | 10 |
| Hazard Note | Keep Cold |
| TSCA | Yes |
| customs code | 29335990 |