(1-methylpiperidin-4-yl)methanol
1-Methyl-4-piperidinemethanol
CAS: 20691-89-8
Molecular Formula: C7H15NO
(1-methylpiperidin-4-yl)methanol - Names and Identifiers
| Name | 1-Methyl-4-piperidinemethanol |
| Synonyms | CHEMBRDG-BB 4002191 1-Methyl-4-piperidinemethano 1-Methylpiperidine-4-methanol N-METHYL-4-PIPERIDINEMETHANOL 1-METHYL-4-PIPERIDINEMETHANOL 1-Methyl-4-piperidinemethanol N-Methyl-4-piperidinemethanol (1-methylpiperidin-4-yl)methanol 4-HYDROXYMETHYL-1-METHYLPIPERIDINE (1-METHYL-PIPERIDIN-4-YL)-METHANOL |
| CAS | 20691-89-8 |
| InChI | InChI=1/C7H15NO/c1-8-4-2-7(6-9)3-5-8/h7,9H,2-6H2,1H3 |
| InChIKey | KJZLJGZZDNGGCA-UHFFFAOYSA-N |
(1-methylpiperidin-4-yl)methanol - Physico-chemical Properties
| Molecular Formula | C7H15NO |
| Molar Mass | 129.2 |
| Density | 0.981 g/mL at 25 °C |
| Boling Point | 108°C/10mmHg(lit.) |
| Flash Point | 110℃ |
| Vapor Presure | 0.159mmHg at 25°C |
| Appearance | Liquid |
| Color | Colorless to yellow |
| pKa | 14.94±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.476 |
(1-methylpiperidin-4-yl)methanol - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 2735 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Hazard Class | IRRITANT |
