(2,4,6-trichlorophenyl)methanol - Names and Identifiers
Name | (2,4,6-trichlorophenyl)methanol
|
Synonyms | (2,4,6-trichlorophenyl)methanol (2,4,6-Trichlorophenyl)Methanol 2 4 6-TRICHLOROBENZYL ALCOHOL 97 BenzeneMethanol, 2,4,6-trichloro-
|
CAS | 217479-60-2
|
InChI | InChI=1/C7H5Cl3O/c8-4-1-6(9)5(3-11)7(10)2-4/h1-2,11H,3H2 |
(2,4,6-trichlorophenyl)methanol - Physico-chemical Properties
Molecular Formula | C7H5Cl3O
|
Molar Mass | 211.47 |
Density | 1.520±0.06 g/cm3(Predicted) |
Melting Point | 98-101 °C (lit.) |
Boling Point | 299.4±35.0 °C(Predicted) |
Flash Point | 134.9°C |
Vapor Presure | 0.000535mmHg at 25°C |
pKa | 13.18±0.10(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.596 |
(2,4,6-trichlorophenyl)methanol - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36 - Wear suitable protective clothing.
|
WGK Germany | 3 |
(2,4,6-trichlorophenyl)methanol - Introduction
(2,4,6-trichlorophenyl)methanol is an organic compound with the chemical formula C7H5Cl3OH. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance:(2,4,6-trichlorophenyl)methanol is a colorless crystal or white solid.
2. Solubility: It has low solubility in water, but it dissolves well in organic solvents.
3. Melting Point: its melting point is about 68-71 ℃.
Use:
1. Chemical Synthesis:(2,4, 6-tricholophenyl) methanol can be used to synthesize other organic compounds, such as fungicides, pesticides and dyes.
2. Pharmaceutical field: It is also used as an intermediate for certain drugs.
Method:
The preparation method of (2,4,6-trichlorophenyl)methanol can be obtained by the reaction of benzoic acid and antimony chloride in the presence of lithium aluminum hydride. The specific steps are as follows:
1. First, benzoic acid reacts with antimony chloride in the presence of lithium aluminum hydride to obtain benzyl antimony chloride.
2. Then, the benzyl antimony chloride reacts with sodium hypochlorite to generate benzyl antimony chloride hypochlorite.
3. Finally, benzylantimony hypochlorite was reacted with sodium chloride to obtain (2,4,6-trichlorophenyl)methanol.
Safety Information:
1. (2,4,6-trichlorophenyl)methanol is an organic compound that may cause certain hazards to human health and the environment.
2. During use or handling, appropriate safety measures should be taken, such as wearing protective gloves, goggles and protective clothing.
3. Avoid contact with skin, eyes and respiratory tract, avoid inhaling its vapor.
4. When leakage or accidental contact occurs, it should be removed immediately, and appropriate treatment and disposal should be carried out.
5. During storage, it should be kept away from fire sources and combustible materials, and stored in a well-ventilated place.
Please note that this is only a general description of (2,4, 6-tricholophenyl) methanol, and that there may be other aspects of the specific nature, use, formulation and safety information to consider, please use caution in specific applications and refer to relevant scientific literature and data.
Last Update:2024-04-09 21:01:54