(4,5-Dimethoxy-2-nitro-phenyl)-methanol
4,5-dimethoxy-2-nitrobenzyl alcohol
CAS: 1016-58-6
Molecular Formula: C9H11NO5
(4,5-Dimethoxy-2-nitro-phenyl)-methanol - Names and Identifiers
| Name | 4,5-dimethoxy-2-nitrobenzyl alcohol |
| Synonyms | RARECHEM AL BD 0187 TIMTEC-BB SBB009964 LABOTEST-BB LT00847721 6-Nitroveratryl alcohol 6-NITROVERATRYL ALCOHOL 4,5-DIMETHOXY-2-NITROBENZYL ALCOHOL 4,5-dimethoxy-2-nitrobenzyl alcohol (4,5-dimethoxy-2-nitrophenyl)methanol (4,5-Dimethoxy-2-nitro-phenyl)-methanol |
| CAS | 1016-58-6 |
| EINECS | 213-806-4 |
| InChI | InChI=1/C9H11NO5/c1-14-8-3-6(5-11)7(10(12)13)4-9(8)15-2/h3-4,11H,5H2,1-2H3 |
(4,5-Dimethoxy-2-nitro-phenyl)-methanol - Physico-chemical Properties
| Molecular Formula | C9H11NO5 |
| Molar Mass | 213.19 |
| Density | 1.307±0.06 g/cm3(Predicted) |
| Melting Point | 145-148 °C (lit.) |
| Boling Point | 383.9±37.0 °C(Predicted) |
| Flash Point | 186°C |
| Water Solubility | Soluble in water. |
| Vapor Presure | 1.4E-06mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Yellow to Green |
| Maximum wavelength(λmax) | ['400nm(CH3CN)(lit.)'] |
| BRN | 1880093 |
| pKa | 13.59±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Light Sensitive |
| Refractive Index | 1.558 |
(4,5-Dimethoxy-2-nitro-phenyl)-methanol - Risk and Safety
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8 |
| HS Code | 29094990 |
| Hazard Class | IRRITANT |
