Name | 2-(4-bromo-3-methoxyphenyl)acetonitrile |
Synonyms | 4-Bromo-3-methoxyphenylacetonitrile (4-Bromo-3-methoxyphenyl)acetonitrile Benzeneacetonitrile, 4-bromo-3-methoxy- 2-(4-bromo-3-methoxyphenyl)acetonitrile 2-(4-broMo-3-Methoxyphenyl)acetonitrile |
CAS | 113081-50-8 |
InChI | InChI=1S/C9H8BrNO/c1-12-9-6-7(4-5-11)2-3-8(9)10/h2-3,6H,4H2,1H3 |
Molecular Formula | C9H8BrNO |
Molar Mass | 226.07 |
Storage Condition | Sealed in dry,Room Temperature |
application | 2-(3-methoxy-4-bromophenyl) acetonitrile can be used as an intermediate in organic synthesis and pharmaceutical intermediate, mainly used in laboratory research and development process and pharmaceutical and chemical production process. |