(4-Methylmorpholin-2-yl)methanamine

(4-Methylmorpholin-2-yl)methanamine - Names and Identifiers

Name	(4-Methylmorpholin-2-yl)methanamine
Synonyms	4-Methyl-2-aminomethylmorpholine 2-Morpholinemethanamine, 4-methyl- (4-Methylmorpholin-2-yl)methanamine (4-METHYLMORPHOLIN-2-YL)METHANAMINE 1-(4-methylmorpholin-2-yl)methanamine 4-Methyl-2-morpholinemethanamine 2HCl 2-Morpholinemethanamine,4-methyl-(9CI)
CAS	141814-57-5
InChI	InChI=1/C6H14N2O/c1-8-2-3-9-6(4-7)5-8/h6H,2-5,7H2,1H3

(4-Methylmorpholin-2-yl)methanamine - Physico-chemical Properties

Molecular Formula	C6H14N2O
Molar Mass	130.19
Density	0.976
Boling Point	189 ºC
Flash Point	68 ºC
Vapor Presure	0.592mmHg at 25°C
Storage Condition	under inert gas (nitrogen or Argon) at 2–8 °C
Refractive Index	1.46

(4-Methylmorpholin-2-yl)methanamine - Introduction

4-Methylmorpholine-2-methylamine (abbreviation: 4-MMA) is an organic compound with the following properties:

Nature:
1. Appearance: colorless liquid or white crystalline solid.
2. Molecular formula: C6H13N.
3. Molecular weight: 99.17g/mol.
4. Melting point:-9°C.
5. Boiling point: 106-107°C.
6. Solubility: Soluble in water and some organic solvents.

Use:
1. as an intermediate in organic synthesis, used in the synthesis of other compounds, such as pharmaceuticals, pesticides and dyes.
2. Used as a surfactant and dispersant, widely used in coatings, adhesives and inks and other industrial fields.

Preparation Method:
4-MMA can be prepared by the following methods:
1. Methylation method: 2-methyl morpholine is reacted with methyl iodide to generate 4-methyl morpholine -2-methyl iodide, which is then reacted with ammonia to obtain 4-MMA.
2. Hydrogenation reduction method: 4-methylmorpholine-2-methanone is reacted with hydrogen in the presence of a catalyst to obtain 4-MMA.

Safety Information:
1. 4-MMA has a stimulating effect on eyes, skin and respiratory tract, and should be protected during operation.
2. encounter fire can produce toxic gas, need to stay away from the fire.
3. Avoid contact with strong oxidants to prevent chemical reactions.
4. 4-MMA has certain toxicity. Direct contact and intake are strictly prohibited. It should be stored properly and avoid contact with children.
5. in the use and storage process should follow the relevant safety practices. In the event of an accident, appropriate first aid measures should be taken immediately and medical assistance should be sought.

Last Update：2024-04-09 15:17:52