(R)-2-Amino-7-methoxy-1,2,3,4-tetrahydronaphthalene
(R)-(+)-7-METHOXY 2-AMINOTETRALIN
CAS: 121216-43-1
Molecular Formula: C11H15NO
(R)-2-Amino-7-methoxy-1,2,3,4-tetrahydronaphthalene - Names and Identifiers
| Name | (R)-(+)-7-METHOXY 2-AMINOTETRALIN |
| Synonyms | 7-Methoxy-2-aminotetralin (R)-2-Amino-7-methoxytetralin (R)-7-METHOXY-2-AMINOTETRALIN (R)-(+)-7-METHOXY 2-AMINOTETRALIN (R)-2-(N-benaylamine)-7-methoxytetralin (R)-7-Methoxy-1,2,3,4-tetrahydro-phthalen-2-ylamine (2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine (R)-2-Amino-7-methoxy-1,2,3,4-tetrahydronaphthalene (R)-7-METHOXY-1,2,3,4-TETRAHYDRO-NAPHTHALEN-2-YLAMINE |
| CAS | 121216-43-1 |
| InChI | InChI=1/C11H15NO/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11/h3,5,7,10H,2,4,6,12H2,1H3/t10-/m1/s1 |
(R)-2-Amino-7-methoxy-1,2,3,4-tetrahydronaphthalene - Physico-chemical Properties
| Molecular Formula | C11H15NO |
| Molar Mass | 177.24 |
| Density | 1.056g/cm3 |
| Boling Point | 299.6°C at 760 mmHg |
| Flash Point | 139.7°C |
| Vapor Presure | 0.00118mmHg at 25°C |
| Refractive Index | 1.547 |
(R)-2-Amino-7-methoxy-1,2,3,4-tetrahydronaphthalene - Introduction
(R)-2-(N-Benzylamino)-7-methoxytetrahydronaphthalene is a compound, also known as (R)-N-Benzyl-2-methoxy-7-tetrahydronaphthalenamine. The following is a description of its nature, use, formulation and safety information:
Nature:
1. Appearance: This compound is colorless to pale yellow crystal.
2. Solubility: It can be dissolved in some organic solvents, such as chloroform, dichloromethane and ethanol.
Use:
(R)-2-(N-benzylamino)-7-methoxytetrahydronaphthalene is commonly used in organic synthesis. It can be used as chiral catalyst and ligand, and participate in asymmetric synthesis reactions, such as asymmetric halogenation reaction, asymmetric alcohol reaction, etc. It can be used to synthesize biologically active compounds or drugs.
Preparation Method:
The preparation of (R)-2-(N-benzylamino)-7-methoxytetrahydronaphthalene can be carried out by the following steps:
1.4-Methoxy -1-naphthalene ethanone is reacted with benzylamine to obtain 4-methoxy -1-benzylamine naphthalene.
2. 4-Methoxy-1-benzylaminonaphthalene is subjected to a reduction reaction with tartrate hydrochloride to obtain (R)-2-(N-benzylamino)-7-methoxytetrahydronaphthalene.
Safety Information:
1. (R)-2-(N-benzylamino)-7-methoxytetrahydronaphthalene needs to be stored in a cool and dry place, away from fire and oxidizing agents.
2. in use, should avoid skin contact and inhalation.
3. During operation, you need to wear appropriate personal protective equipment, such as gloves, goggles and protective masks.
4. For accidental exposure or inhalation, get medical help immediately and go to a medical facility with the product packaging or label.
Nature:
1. Appearance: This compound is colorless to pale yellow crystal.
2. Solubility: It can be dissolved in some organic solvents, such as chloroform, dichloromethane and ethanol.
Use:
(R)-2-(N-benzylamino)-7-methoxytetrahydronaphthalene is commonly used in organic synthesis. It can be used as chiral catalyst and ligand, and participate in asymmetric synthesis reactions, such as asymmetric halogenation reaction, asymmetric alcohol reaction, etc. It can be used to synthesize biologically active compounds or drugs.
Preparation Method:
The preparation of (R)-2-(N-benzylamino)-7-methoxytetrahydronaphthalene can be carried out by the following steps:
1.4-Methoxy -1-naphthalene ethanone is reacted with benzylamine to obtain 4-methoxy -1-benzylamine naphthalene.
2. 4-Methoxy-1-benzylaminonaphthalene is subjected to a reduction reaction with tartrate hydrochloride to obtain (R)-2-(N-benzylamino)-7-methoxytetrahydronaphthalene.
Safety Information:
1. (R)-2-(N-benzylamino)-7-methoxytetrahydronaphthalene needs to be stored in a cool and dry place, away from fire and oxidizing agents.
2. in use, should avoid skin contact and inhalation.
3. During operation, you need to wear appropriate personal protective equipment, such as gloves, goggles and protective masks.
4. For accidental exposure or inhalation, get medical help immediately and go to a medical facility with the product packaging or label.
Last Update：2024-04-09 15:17:51
