(R)-BoroPro-(+)-Pinediol-HCl

(R)-BoroPro-(+)-Pinediol-HCl - Names and Identifiers

Name	(R)-BoroPro-(+)-Pinanediol-HCl
Synonyms	(R)-BoroPro-(+)-Pinediol-HCl (R)-BoroPro-(+)-Pinanediol-HCl (R)-BoroPro-(+)-Pinanediol-hydrochloride (r)-2-pyrrolidineboronic acid pinanediol ester (R)-2-Pyrrolidineboronicacidpinanediolesterhydrochloride (R)-1H-Pyrrolidine-2-boronic acid, pinanediol ester, HCl (R)-2-Pyrrolidineboronic acid pinanediol ester hydrochloride (R)-2-((3aS,4S,6S,7aR)-3a,5,5-TriMethylhexahydro-4,6-Methanobenzo[d][1,3,2]dioxaborol-2-yl)pyrrolidine hydrochloride
CAS	147208-69-3
InChI	InChI=1/C14H24BNO2.ClH/c1-13(2)9-7-10(13)14(3)11(8-9)17-15(18-14)12-5-4-6-16-12;/h9-12,16H,4-8H2,1-3H3;1H/t9-,10-,11+,12-,14-;/m0./s1

(R)-BoroPro-(+)-Pinediol-HCl - Physico-chemical Properties

Molecular Formula	C14H24BNO2.ClH
Molar Mass	285.621
Storage Condition	Sealed in dry,Room Temperature

(R)-BoroPro-(+)-Pinediol-HCl - Introduction

(R)-BoroPro-( )-Pinanediol-HCl, also known as (R)-PipBPin · HCl, is a compound with the following properties:

1. Appearance: white solid.
2. Melting Point: about 125-127 ° C.
3. Solubility: soluble in some organic solvents, such as dimethyl sulfoxide and dimethylformamide.
4. Structure: The compound has Topological chirality and can be used as a catalyst for cysteine residue pseudoenzyme (Sa-FadD32S).

The compound has a wide range of applications in chemical research, mainly including the following aspects:

1. Catalyst: It can be used as a catalyst for cysteine residue pseudo-enzyme (Sa-FadD32S) to catalyze chiral esterification and amino acid esterification.
2. Fine chemicals synthesis: for the synthesis of drugs and organic compounds with chiral environment.
3. Drug research: as a drug synthesis intermediate, used in the synthesis of chiral drugs.

The method of preparing (R)-PipBPin · HCl usually involves the following steps:

1. Synthesis of (R)-2-pyrrolidine boronic acid pinanediol ester: Obtain by reacting (R)-2-pyrrolidine with dimethyl borate.
2. Preparation of Hydrochloride: (R)-2-pyrrolidine boronic acid pinanediol Ester is reacted with hydrochloric acid to generate (R)-PipBPin · HCl.

Regarding safety information, due to the application of (R)-PipBPin · HCl in chemical laboratories, appropriate safety measures need to be taken:

1. Avoid inhalation: it should be operated in a well-ventilated place to avoid inhalation of dust or steam.
2. Avoid contact with skin and eyes: Wear appropriate personal protective equipment, such as gloves and goggles, when using the compound.
3. Storage: The compound should be stored in a sealed container, avoiding contact with air and moisture.

Last Update：2024-04-09 21:04:16