(S)-1,5-dimethylpiperazin-2-one - Names and Identifiers
Name | (S)-1,5-dimethylpiperazin-2-one
|
Synonyms | (S)-1,5-DIMETHYLPIPERAZIN-2-ONE (S)-1,5-dimethylpiperazin-2-one (5S)-1,5-Dimethyl-2-piperazinone (5S)-1,5-dimethylpiperazin-2-one 2-Piperazinone, 1,5-dimethyl-, (5S)- (S)-1,5-dimethylpiperazin-2-one hydrochloride
|
CAS | 1068149-94-9
|
InChI | InChI=1S/C6H12N2O/c1-5-4-8(2)6(9)3-7-5/h5,7H,3-4H2,1-2H3/t5-/m0/s1 |
(S)-1,5-dimethylpiperazin-2-one - Physico-chemical Properties
Molecular Formula | C6H12N2O
|
Molar Mass | 128.17 |
Density | 0.985 |
Boling Point | 243℃ |
Flash Point | 101℃ |
pKa | 7.49±0.40(Predicted) |
Storage Condition | 2-8°C(protect from light) |
(S)-1,5-dimethylpiperazin-2-one - Introduction
(S)-1,5-Dimethylpiperazin -2-one is a chemical substance with the following properties:
1. Appearance: colorless or yellowish solid.
2. solubility: soluble in some organic solvents, such as alcohols and ethers.
3. melting point: about 95-98 degrees Celsius.
4. molecular formula: C8H14N2O.
5. optical activity: with chirality, that is, there are (S) and (R) two configurations.
The main uses of (S)-1,5-dimethylpiperazin -2-one include:
1. Drug synthesis: It can be used as a drug intermediate and raw material for the synthesis of some biologically active substances, such as antiepileptic drugs and sedatives.
2. Catalyst: It can be used as a chiral catalyst to participate in asymmetric synthesis reactions for the preparation of chiral compounds.
The method for preparing (S)-1,5-dimethylpiperazin -2-one can be carried out by the following steps:
1. First, piperazine is used as the starting material and converted into (S)-2-piperazinol through a series of chemical reactions.
2. Then, (S)-1,5-dimethylpiperazine -2-one was synthesized from (S)-2-piperazinol through esterification and reduction.
For safety information,(S)-1,5-dimethylpiperazin -2-one should be stored and used in a well-ventilated environment, avoiding contact with skin, eyes and respiratory tract. Care should be taken to avoid inhalation, swallowing or contact with the substance. If inhaled or touched by mistake, rinse immediately with water and seek medical help. For the use and handling of these chemicals, it is recommended to comply with the appropriate safety practices and personal protective measures.
Last Update:2024-04-09 21:01:54