(S)-4-Bromophenylalanine
4-bromo-L-phenylalanine
CAS: 24250-84-8
Molecular Formula: C9H10BrNO2
(S)-4-Bromophenylalanine - Names and Identifiers
| Name | 4-bromo-L-phenylalanine |
| Synonyms | L-4-Bromophe L-4-Br-Phe-OH 4-Bromo-Phe-OH H-Phe(4-Br)-OH Fmoc-HomoArg-OH 4-Bromo-L-Phe-OH H-p-Bromo-Phe-OH H-Phe(4-Br)-OH·HCl L-4-Bromophenylalanine 4-bromo-L-phenylalanine Bromo-L-Phenylalanine,4- (S)-4-Bromophenylalanine (S)-4-Bromophenylalanine Hydrochloride Salt (S)-2-Amino-3-(4'-Bromophenyl)Propanoic Acid (2S)-2-Amino-3-(4'-bromophenyl)propanoic acid (2S)-2-amino-3-(4-bromophenyl)propanoic acid hydrochloride |
| CAS | 24250-84-8 |
| InChI | InChI=1/C9H10BrNO2.ClH/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;/h1-4,8H,5,11H2,(H,12,13);1H/t8-;/m0./s1 |
(S)-4-Bromophenylalanine - Physico-chemical Properties
| Molecular Formula | C9H10BrNO2 |
| Molar Mass | 244.09 |
| Density | 1.588±0.06 g/cm3(Predicted) |
| Melting Point | ~265°C (dec.) |
| Boling Point | 368.4±32.0 °C(Predicted) |
| Flash Point | 192.6°C |
| Solubility | Methanol (Slightly, Sonicated), Water (Slightly, Heated, Sonicated) |
| Vapor Presure | 6.06E-07mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| BRN | 2212159 |
| pKa | 2.18±0.10(Predicted) |
| Storage Condition | Store at RT. |
| Stability | Hygroscopic |
(S)-4-Bromophenylalanine - Risk and Safety
| Risk Codes | 25 - Toxic if swallowed |
| Safety Description | 45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN2811 |
| WGK Germany | 3 |
| Hazard Class | 6.1 |
| Packing Group | III |
(S)-4-Bromophenylalanine - Introduction
4-bromo-L-phenylalanine(4-bromo-L-phenylalanine) is an organic compound with the chemical formula C9H10BrNO2 and a molecular weight of 246.08g/mol. It is a derivative of phenylalanine in which the amino acid L-phenylalanine has a bromine atom substituted for carbon 4.
The compound was in the form of a white or slightly yellow crystalline powder. It is insoluble in water at room temperature, but soluble in some organic solvents such as acetic acid, methanol and dimethyl sulfoxide. It has a higher melting point and boiling point and is more stable in air.
4-bromo-L-phenylalanine is mainly used in biochemical, biological and pharmaceutical research fields. It can be used as an intermediate in the synthesis of potential drug molecules for the development of anti-cancer drugs and anti-infective drugs. It can also be used to study the catalytic mechanism of enzymes, protein interactions and molecular recognition processes.
The common method for preparing 4-bromo-L-phenylalanine is by reacting phenylalanine with a bromination reagent (such as iodine tetrabromide). The reaction is typically carried out under an inert atmosphere to avoid the production of unwanted by-products.
In terms of safety, as 4-bromo-L-phenylalanine has not yet become a common drug or chemical, specific data on its toxicity and safety are limited. However, since it is an organic compound, care should be taken to avoid direct contact with skin and eyes when using it, and to ensure that it is operated under well-ventilated conditions. During handling, laboratory safety practices should be followed, and the compound should be stored and disposed of properly. If the compound needs to be used, it is recommended to do so under the guidance of an experienced chemistry professional.
The compound was in the form of a white or slightly yellow crystalline powder. It is insoluble in water at room temperature, but soluble in some organic solvents such as acetic acid, methanol and dimethyl sulfoxide. It has a higher melting point and boiling point and is more stable in air.
4-bromo-L-phenylalanine is mainly used in biochemical, biological and pharmaceutical research fields. It can be used as an intermediate in the synthesis of potential drug molecules for the development of anti-cancer drugs and anti-infective drugs. It can also be used to study the catalytic mechanism of enzymes, protein interactions and molecular recognition processes.
The common method for preparing 4-bromo-L-phenylalanine is by reacting phenylalanine with a bromination reagent (such as iodine tetrabromide). The reaction is typically carried out under an inert atmosphere to avoid the production of unwanted by-products.
In terms of safety, as 4-bromo-L-phenylalanine has not yet become a common drug or chemical, specific data on its toxicity and safety are limited. However, since it is an organic compound, care should be taken to avoid direct contact with skin and eyes when using it, and to ensure that it is operated under well-ventilated conditions. During handling, laboratory safety practices should be followed, and the compound should be stored and disposed of properly. If the compound needs to be used, it is recommended to do so under the guidance of an experienced chemistry professional.
Last Update：2024-04-09 21:04:16
