(αR)-α-Isopropylbenzenemethanol
(R)-(+)-2-methyl-1-phenyl-1-propanol
CAS: 14898-86-3
Molecular Formula: C10H14O
(αR)-α-Isopropylbenzenemethanol - Names and Identifiers
| Name | (R)-(+)-2-methyl-1-phenyl-1-propanol |
| Synonyms | 2-methyl-1-phenylpropan-1-ol (αR)-α-Isopropylbenzyl alcohol (αR)-α-Isopropylbenzenemethanol (R)-2-METHYL-1-PHENYLPROPAN-1-OL (1R)-2-methyl-1-phenylpropan-1-ol (R)-(+)-2-METHYL-1-PHENYLPROPANOL (1R)-1-Phenyl-2-methylpropane-1-ol (R)-(+)-2-methyl-1-phenyl-1-propanol (R)-(+)-2-METHYL-1-PHENYL-1-PROPANOL Benzenemethanol, alpha-(1-methylethyl)-, (R)- |
| CAS | 14898-86-3 |
| EINECS | 210-274-5 |
| InChI | InChI=1/C10H14O/c1-8(2)10(11)9-6-4-3-5-7-9/h3-8,10-11H,1-2H3/t10-/m1/s1 |
(αR)-α-Isopropylbenzenemethanol - Physico-chemical Properties
| Molecular Formula | C10H14O |
| Molar Mass | 150.22 |
| Density | 0,964 g/cm3 |
| Boling Point | 124-125°C 15mm |
| Flash Point | 86°C |
| Vapor Presure | 0.0678mmHg at 25°C |
| pKa | 14.29±0.20(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.513(lit.) |
(αR)-α-Isopropylbenzenemethanol - Risk and Safety
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
(αR)-α-Isopropylbenzenemethanol - Introduction
(R)-(+)-2-methyl-1-phenyl-1-propanol is a chiral alcohol compound with the following properties:
1. Appearance: colorless liquid or white crystal.
2. Flavor: with a sweet flavor.
3. Optical activity: it is a kind of rotatory body, can make polarized light optical rotation phenomenon.
4. Solubility: Soluble in many organic solvents, such as ether, alcohol and ketone.
5. Melting Point: about 80-82 ° C.
6. Boiling Point: about 195-198 C.
(R)-( )-2-methyl-1-phenyl-1-propanol is often used as a chiral reagent and catalyst in organic reactions, and has a wide range of applications:
1. Synthesis of chiral compounds in Organic Synthesis: as chiral alcohols, it can be used to synthesize chiral drugs, pesticides, spices and other organic compounds.
2. Catalyst: It can be used as a chiral catalyst in organic reactions, such as asymmetric reduction reactions, oxidation reactions, etc.
3. Optical material: As an optically active substance, it can be used in the field of optical materials.
(R)-( )-2-methyl-1-phenyl-1-propanol has many preparation methods, the common one is through the reaction of thionyl chloride with P-tolylmethanol, and then deprotection to obtain the final product.
The safety information for (R)-( )-2-methyl-1-phenyl-1-propanol is as follows:
1. Need to be stored in a sealed container, away from heat and fire sources.
2. Use should wear appropriate protective equipment, such as gloves, protective glasses and protective clothing.
3. Avoid contact with skin, eyes and respiratory tract.
4. Maintain good ventilation during use.
5. If ingested or inhaled, seek medical attention immediately.
Please note that the above information is for reference only. If you need to use this compound, please read and follow the relevant safety guidelines and operating procedures carefully.
1. Appearance: colorless liquid or white crystal.
2. Flavor: with a sweet flavor.
3. Optical activity: it is a kind of rotatory body, can make polarized light optical rotation phenomenon.
4. Solubility: Soluble in many organic solvents, such as ether, alcohol and ketone.
5. Melting Point: about 80-82 ° C.
6. Boiling Point: about 195-198 C.
(R)-( )-2-methyl-1-phenyl-1-propanol is often used as a chiral reagent and catalyst in organic reactions, and has a wide range of applications:
1. Synthesis of chiral compounds in Organic Synthesis: as chiral alcohols, it can be used to synthesize chiral drugs, pesticides, spices and other organic compounds.
2. Catalyst: It can be used as a chiral catalyst in organic reactions, such as asymmetric reduction reactions, oxidation reactions, etc.
3. Optical material: As an optically active substance, it can be used in the field of optical materials.
(R)-( )-2-methyl-1-phenyl-1-propanol has many preparation methods, the common one is through the reaction of thionyl chloride with P-tolylmethanol, and then deprotection to obtain the final product.
The safety information for (R)-( )-2-methyl-1-phenyl-1-propanol is as follows:
1. Need to be stored in a sealed container, away from heat and fire sources.
2. Use should wear appropriate protective equipment, such as gloves, protective glasses and protective clothing.
3. Avoid contact with skin, eyes and respiratory tract.
4. Maintain good ventilation during use.
5. If ingested or inhaled, seek medical attention immediately.
Please note that the above information is for reference only. If you need to use this compound, please read and follow the relevant safety guidelines and operating procedures carefully.
Last Update：2024-04-09 15:17:52
