1,2,3,4-tetrahydro-5H-1-benzazepin-5-one - Names and Identifiers
Name | 1,2,3,4-Tetrahydro-benzo[b]azepin-5-one
|
Synonyms | 1,2,3,4-Tetrahydrobenzoazepine-5-one 1,2,3,4-tetrahydrobenzo[b]azepin-5-one 5-oxo-2,3,4,5-tetrahydro-1H-benzazepine 1,2,3,4-TETRAHYDRO-BENZO[B]AZEPIN-5-ONE 1,2,3,4-Tetrahydro-benzo[b]azepin-5-one 1,2,3,4-tetrahydrobenzo[b]azepin-5-tone 1,2,3,4-Tetrahydro-5H-1-benzazepin-5-one 1,2,3,4-tetrahydro-5H-1-benzazepin-5-one 5H-1-Benzazepin-5-one, 1,2,3,4-tetrahydro- 1,2,3,4-tetrahydro-5H-benzo[b]azepin-5-one
|
CAS | 1127-74-8
|
EINECS | 672-555-2 |
InChI | InChI=1/C10H11NO/c12-10-6-3-7-11-9-5-2-1-4-8(9)10/h1-2,4-5,11H,3,6-7H2 |
1,2,3,4-tetrahydro-5H-1-benzazepin-5-one - Physico-chemical Properties
Molecular Formula | C10H11NO
|
Molar Mass | 161.2 |
Density | 1.100±0.06 g/cm3(Predicted) |
Melting Point | 87-88℃ |
Boling Point | 314.6±12.0 °C(Predicted) |
Flash Point | 142.8°C |
Vapor Presure | 0.000461mmHg at 25°C |
Appearance | Powder |
Color | White to light green |
pKa | 3.05±0.20(Predicted) |
Storage Condition | 2-8°C(protect from light) |
Refractive Index | 1.547 |
MDL | MFCD03426404 |
1,2,3,4-tetrahydro-5H-1-benzazepin-5-one - Risk and Safety
1,2,3,4-tetrahydro-5H-1-benzazepin-5-one - Introduction
1,2, 3,4-Tetrahydrobenzo [B] azepin-5-one, also known as tetrahydropyrimidinone, has the following properties:
1. Appearance: Tetrahydropyrimidinone is colorless crystal or white crystalline powder.
2. Solubility: It has low solubility in water and can be well dissolved in organic solvents.
3. Stability: Tetrahydropyrimidinone is a relatively stable compound, but it may decompose or deteriorate under high temperature, acidic or alkaline conditions.
4. ignition point: it has a high ignition point and can burn in case of open fire.
Uses of tetrahydropyrimidinones include:
1. Drug synthesis: It is often used as an intermediate for the synthesis of drugs and bioactive molecules.
2. chemical: tetrahydropyrimidinone is widely used as a solvent or reaction medium.
3. pigment: some organic pigments contain tetrahydropyrimidinone.
The production method of tetrahydropyrimidinone is usually obtained by a method of hydrogenating tetrahydropyrimidine or pyridine oxide. The specific preparation method can be selected according to actual needs, but safety needs to be paid attention to during operation.
Regarding safety information, tetrahydropyrimidinones are chemicals, so the following safety measures need to be strictly observed:
1. Avoid contact with skin, eyes and respiratory tract.
2. Wear appropriate protective equipment such as safety glasses, gloves and protective clothing during use.
3. storage should avoid contact with oxidants, acids and combustibles.
4. Use in a well-ventilated place, away from open flames and heat sources.
5. When disposing of waste, it should be treated and disposed in accordance with relevant regulations.
Last Update:2024-04-09 20:49:11