1,2-Bis(4-pyridyl)ethane,4,4′-Ethylenedipyridine
1,2-Bis(4-pyridyl)ethane
CAS: 4916-57-8
Molecular Formula: C12H12N2
1,2-Bis(4-pyridyl)ethane,4,4′-Ethylenedipyridine - Names and Identifiers
| Name | 1,2-Bis(4-pyridyl)ethane |
| Synonyms | 4,4'-ETHYLENEDIPYRIDINE 1,2-Bis(4-pyridyl)ethane 1,2-BIS(4-PYRIDYL)ETHANE 4,4'-Ethylenebispyridine 1,2-DI-(4-PYRIDYL) ETHANE 4,4'-Ethylenebis(pyridine) 1,2-Bis(4-pyridyl)ethane (BPA) 1,2-Bis(4-pyridyl)ethane,4,4′-Ethylenedipyridine |
| CAS | 4916-57-8 |
| EINECS | 225-543-2 |
| InChI | InChI=1/C12H12N2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h3-10H,1-2H2 |
1,2-Bis(4-pyridyl)ethane,4,4′-Ethylenedipyridine - Physico-chemical Properties
| Molecular Formula | C12H12N2 |
| Molar Mass | 184.24 |
| Density | 1.1160 (rough estimate) |
| Melting Point | 110-112 °C (lit.) |
| Boling Point | 174 °C / 3mmHg |
| Flash Point | 117.2°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.00111mmHg at 25°C |
| Appearance | Crystals or Crystalline Powder |
| Color | White to light yellow or pinkish |
| pKa | 6.13±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.6266 (estimate) |
| MDL | MFCD00006451 |
1,2-Bis(4-pyridyl)ethane,4,4′-Ethylenedipyridine - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29339900 |
1,2-Bis(4-pyridyl)ethane,4,4′-Ethylenedipyridine - Introduction
1,2-Bis(4-pyridyl)ethane is an organic compound with the chemical formula C12H12N2. The following is a description of its nature, use, preparation and safety information:
Nature:
1,2-Bis(4-pyridyl)ethane is a colorless crystal that can be dissolved in most organic solvents, such as ethanol, acetone and benzene. It has a lower melting point and boiling point.
Use:
1,2-Bis(4-pyridyl)ethane has a wide range of applications in coordination chemistry. It can be used as a ligand to form coordination compounds with transition metal ions for catalytic reactions, fluorescence analysis, and synthesis of porous materials.
Preparation Method:
The method for preparing 1,2-Bis(4-pyridyl)ethane is relatively simple and is generally carried out through the following steps:
1. First, 4-pyridinecarboxaldehyde is reacted with ethylenediamine in a suitable solvent to generate 1,2-bis (4-pyridine) ethanol.
2. Next, 1,2-bis (4-pyridyl) ethanol and pyrophosphoric acid under acidic conditions are subjected to condensation reaction to obtain 1,2-Bis(4-pyridyl)ethane.
Safety Information:
1,2-Bis(4-pyridyl)ethane is relatively safe under general conditions, but the following matters still need to be paid attention:
1. Avoid contact with skin, eyes and respiratory tract. Wear appropriate personal protective equipment, such as safety glasses, gloves and protective masks.
2. avoid inhaling gas, fly ash or steam. Good ventilation equipment and environment should be ensured during operation.
3. Store away from fire and oxidizing agents, store in a sealed container, and avoid exposure to direct sunlight.
4. Follow local safety procedures and laws and regulations during use or disposal.
Please note that the correct laboratory operation methods should be followed when using chemicals, and do not try to synthesize or handle toxic or dangerous substances without professional guidance.
Nature:
1,2-Bis(4-pyridyl)ethane is a colorless crystal that can be dissolved in most organic solvents, such as ethanol, acetone and benzene. It has a lower melting point and boiling point.
Use:
1,2-Bis(4-pyridyl)ethane has a wide range of applications in coordination chemistry. It can be used as a ligand to form coordination compounds with transition metal ions for catalytic reactions, fluorescence analysis, and synthesis of porous materials.
Preparation Method:
The method for preparing 1,2-Bis(4-pyridyl)ethane is relatively simple and is generally carried out through the following steps:
1. First, 4-pyridinecarboxaldehyde is reacted with ethylenediamine in a suitable solvent to generate 1,2-bis (4-pyridine) ethanol.
2. Next, 1,2-bis (4-pyridyl) ethanol and pyrophosphoric acid under acidic conditions are subjected to condensation reaction to obtain 1,2-Bis(4-pyridyl)ethane.
Safety Information:
1,2-Bis(4-pyridyl)ethane is relatively safe under general conditions, but the following matters still need to be paid attention:
1. Avoid contact with skin, eyes and respiratory tract. Wear appropriate personal protective equipment, such as safety glasses, gloves and protective masks.
2. avoid inhaling gas, fly ash or steam. Good ventilation equipment and environment should be ensured during operation.
3. Store away from fire and oxidizing agents, store in a sealed container, and avoid exposure to direct sunlight.
4. Follow local safety procedures and laws and regulations during use or disposal.
Please note that the correct laboratory operation methods should be followed when using chemicals, and do not try to synthesize or handle toxic or dangerous substances without professional guidance.
Last Update：2024-04-10 22:29:15
Supplier List
Spot supply
Product Name: 1,2-Bis(4-Pyridyl)Ethane Visit Supplier Webpage Request for quotationCAS: 4916-57-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: 1,2-Bis(4-Pyridyl)Ethane Visit Supplier Webpage Request for quotationCAS: 4916-57-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History