1,3-Dimethyl-4-nitrobenzene
4-Nitro-m-xylene
CAS: 89-87-2
Molecular Formula: C8H9NO2
1,3-Dimethyl-4-nitrobenzene - Names and Identifiers
| Name | 4-Nitro-m-xylene |
| Synonyms | Nitromxylene 4-Nitro-m-xylene 2,4-Dimethylnitrobenzene 2,4-Dimethy Nitrobenzene 4-Nitro-1,3-Dimethylbenzene 1,3-Dimethyl-4-nitrobenzene 2,4-dimethyl-1-nitrobenzene |
| CAS | 89-87-2 |
| EINECS | 201-947-4 |
| InChI | InChI=1/C8H9NO2/c1-6-3-4-8(9(10)11)7(2)5-6/h3-5H,1-2H3 |
1,3-Dimethyl-4-nitrobenzene - Physico-chemical Properties
| Molecular Formula | C8H9NO2 |
| Molar Mass | 151.163 |
| Density | 1.129g/cm3 |
| Melting Point | 5-7℃ |
| Boling Point | 244.1°C at 760 mmHg |
| Flash Point | 107.2°C |
| Water Solubility | 133 mg/L (20℃) |
| Vapor Presure | 0.0483mmHg at 25°C |
| Refractive Index | 1.547 |
1,3-Dimethyl-4-nitrobenzene - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | UN 1665 |