1-(2,3-difluoro-6-nitrophenyl)-2-propanone
3-Acetylmethyl-1,2-difluoro-4-nitrobenzene
CAS: 121247-16-3
Molecular Formula: C9H7F2NO3
1-(2,3-difluoro-6-nitrophenyl)-2-propanone - Names and Identifiers
| Name | 3-Acetylmethyl-1,2-difluoro-4-nitrobenzene |
| Synonyms | 1-(2,3-Difluoro-6-nitrophenyl) 3-Acetylmethyl-1,2-difluoro-4-nitrobenzene 1-(2,3-difluoro-6-nitrophenyl)-2-propanone 1-(2,3-Difluoro-6-nitrophenyl)propan-2-one 3-acetylmethyl -1.2-difluoro-4-nitrobenzene 2-Propanone, 1-(2,3-difluoro-6-nitrophenyl)- |
| CAS | 121247-16-3 |
| InChI | InChI=1/C9H7F2NO3/c1-5(13)4-6-8(12(14)15)3-2-7(10)9(6)11/h2-3H,4H2,1H3 |
1-(2,3-difluoro-6-nitrophenyl)-2-propanone - Physico-chemical Properties
| Molecular Formula | C9H7F2NO3 |
| Molar Mass | 215.15 |
| Density | 1.378g/cm3 |
| Boling Point | 283.4°C at 760 mmHg |
| Flash Point | 125.196°C |
| Vapor Presure | 0.003mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.514 |
1-(2,3-difluoro-6-nitrophenyl)-2-propanone - Introduction
1.2-Difluoro-3-acetylmethyl-4-nitrobenzene is an organic compound with the chemical formula C9H7F2NO3.
The properties of the compound are as follows:
1. appearance and properties: 1.2-difluoro -3-acetyl methyl -4-nitrobenzene is colorless or light yellow crystal or powder.
2. melting point and boiling point: the melting point of the compound is 104-105 ℃, and the boiling point is 310 ℃.
3. Solubility: 1.2-difluoro -3-acetyl methyl -4-nitrobenzene is soluble in some organic solvents, such as ethanol, chloroform and dichloromethane.
4. chemical properties: the compound is a benzene ring compound containing two fluorine and nitro groups, with strong electron affinity and oxidation.
The main uses of this compound are as follows:
1. as an intermediate in organic synthesis: 1.2-difluoro -3-acetyl methyl -4-nitrobenzene can be used as an intermediate in the synthesis of other organic compounds, such as drugs, pesticides and dyes.
The method for preparing 1.2-difluoro -3-acetyl methyl -4-nitrobenzene is as follows:
The compound can be obtained by reacting 1,2-difluoro -4-nitrobenzene with acetic anhydride under the catalysis of sulfuric acid.
Regarding safety information, because 1.2-difluoro-3-acetylmethyl-4-nitrobenzene is an organic compound, it has certain toxicity and danger. Use should pay attention to the following matters:
1. Avoid contact with skin and eyes: contact with skin can cause irritation and allergic reactions, contact with eyes may cause irritation and damage.
2. Avoid inhalation and intake: avoid inhaling the dust or vapor of the compound, and avoid eating by mistake.
3. Pay attention to protective measures: When handling the compound, you should wear appropriate protective equipment, such as laboratory gloves and protective glasses.
4. Storage conditions: Store 1.2-difluoro -3-acetyl methyl -4-nitrobenzene in a dry, cool and well-ventilated place, away from fire and flammable materials.
The properties of the compound are as follows:
1. appearance and properties: 1.2-difluoro -3-acetyl methyl -4-nitrobenzene is colorless or light yellow crystal or powder.
2. melting point and boiling point: the melting point of the compound is 104-105 ℃, and the boiling point is 310 ℃.
3. Solubility: 1.2-difluoro -3-acetyl methyl -4-nitrobenzene is soluble in some organic solvents, such as ethanol, chloroform and dichloromethane.
4. chemical properties: the compound is a benzene ring compound containing two fluorine and nitro groups, with strong electron affinity and oxidation.
The main uses of this compound are as follows:
1. as an intermediate in organic synthesis: 1.2-difluoro -3-acetyl methyl -4-nitrobenzene can be used as an intermediate in the synthesis of other organic compounds, such as drugs, pesticides and dyes.
The method for preparing 1.2-difluoro -3-acetyl methyl -4-nitrobenzene is as follows:
The compound can be obtained by reacting 1,2-difluoro -4-nitrobenzene with acetic anhydride under the catalysis of sulfuric acid.
Regarding safety information, because 1.2-difluoro-3-acetylmethyl-4-nitrobenzene is an organic compound, it has certain toxicity and danger. Use should pay attention to the following matters:
1. Avoid contact with skin and eyes: contact with skin can cause irritation and allergic reactions, contact with eyes may cause irritation and damage.
2. Avoid inhalation and intake: avoid inhaling the dust or vapor of the compound, and avoid eating by mistake.
3. Pay attention to protective measures: When handling the compound, you should wear appropriate protective equipment, such as laboratory gloves and protective glasses.
4. Storage conditions: Store 1.2-difluoro -3-acetyl methyl -4-nitrobenzene in a dry, cool and well-ventilated place, away from fire and flammable materials.
Last Update：2024-04-09 21:04:16
Supplier List
Product Name: Lenalidomide Impurity 64 Request for quotation
CAS: 121247-16-3
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
CAS: 121247-16-3
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: 3-Acetylmethyl-1,2-difluoro-4-nitrobenzene Visit Supplier Webpage Request for quotation
CAS: 121247-16-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 121247-16-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Lenalidomide Impurity 64 Request for quotation
CAS: 121247-16-3
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
CAS: 121247-16-3
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: 3-Acetylmethyl-1,2-difluoro-4-nitrobenzene Visit Supplier Webpage Request for quotation
CAS: 121247-16-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 121247-16-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History