1-(3-CHLOROPHENYL)PIPERAZINE
1-(3-Chlorophenyl)piperazine
CAS: 6640-24-0
Molecular Formula: C10H13ClN2
1-(3-CHLOROPHENYL)PIPERAZINE - Names and Identifiers
| Name | 1-(3-Chlorophenyl)piperazine |
| Synonyms | MCPP RARECHEM AH CK 0071 TIMTEC-BB SBB003579 3-Chlorphenylpiperazine 3-Chlorophenyl piperazine N-(3-CHLOROPHENYL)PIPERAZINE 1-(3-Chlorphenyl)-piperazine 1-(3-Chlorophenyl)piperazine 1-(3-CHLORPHENYL)-PIPERAZINE 1-(3-CHLOROPHENYL)PIPERAZINE 1-(3-Chlorophenyl)-piperazine 1-(3-CHLOROPHENYL)PIPERAZINE (MCPP) |
| CAS | 6640-24-0 |
| EINECS | 229-654-7 |
| InChI | InChI=1/C10H13ClN2/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2 |
1-(3-CHLOROPHENYL)PIPERAZINE - Physico-chemical Properties
| Molecular Formula | C10H13ClN2 |
| Molar Mass | 196.68 |
| Density | 1.193 |
| Melting Point | 210-214°C |
| Boling Point | 105 °C |
| Flash Point | 157.2°C |
| Solubility | Chloroform (Slightly), Methanol (Sparingly) |
| Vapor Presure | 0.000112mmHg at 25°C |
| Appearance | Oil |
| Color | Colourless to Orange |
| pKa | 8.85±0.10(Predicted) |
| Storage Condition | -20°C Freezer, Under Inert Atmosphere |
| Refractive Index | 1,598-1,600 |
1-(3-CHLOROPHENYL)PIPERAZINE - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36 - Wear suitable protective clothing. |
| HS Code | 29339900 |
| Hazard Class | IRRITANT |
