1-(4-Fluorophenoxy)-3-iodobenzene
4-FLUORO-3'-IODODIPHENYL ETHER
CAS: 188534-09-0
Molecular Formula: C12H8FIO
1-(4-Fluorophenoxy)-3-iodobenzene - Names and Identifiers
| Name | 4-FLUORO-3'-IODODIPHENYL ETHER |
| Synonyms | 3-(4-Fluorophenoxy)iodobenzene 4-FLUORO-3'-IODODIPHENYL ETHER 4-Fluorophenyl 3-iodophenyl ether 1-(4-Fluorophenoxy)-3-iodobenzene Benzene, 1-(4-fluorophenoxy)-3-iodo- |
| CAS | 188534-09-0 |
| InChI | InChI=1/C12H8FIO/c13-9-4-6-11(7-5-9)15-12-3-1-2-10(14)8-12/h1-8H |
1-(4-Fluorophenoxy)-3-iodobenzene - Physico-chemical Properties
| Molecular Formula | C12H8FIO |
| Molar Mass | 314.09 |
| Density | 1.685±0.06 g/cm3(Predicted) |
| Melting Point | 52-54°C |
| Boling Point | 324.6±27.0 °C(Predicted) |
| Flash Point | 150.1°C |
| Vapor Presure | 0.000462mmHg at 25°C |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.621 |
1-(4-Fluorophenoxy)-3-iodobenzene - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Hazard Class | IRRITANT |
1-(4-Fluorophenoxy)-3-iodobenzene - Introduction
4-FLUORO-3 '-IODODIPHENYL ETHER is an organic compound with the chemical formula C12H8FIO. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: 4-FLUORO-3 '-IODODIPHENYL ETHER is a colorless crystalline solid.
2. Melting Point: about 57-59 degrees Celsius.
3. Boiling point: About 290-300 degrees Celsius.
4. High stability at room temperature.
5. Insoluble in water, better solubility in organic solvents.
Use:
1. Intermediate: 4-FLUORO-3 '-IODODIPHENYL ETHER can be used as an intermediate in organic synthesis reactions for the synthesis of other organic compounds.
2. Pharmaceutical field: It also has certain applications in some drug research and development fields.
Method:
4-FLUORO-3 '-IODODIPHENYL ETHER can be prepared by fluorination of phenol and iodobenzene in the presence of hydrofluoric acid. The specific steps are firstly adding phenol and iodobenzene into a reaction flask, reacting for a period of time after adding hydrofluoric acid, and then extracting and purifying.
Safety Information:
1. 4-FLUORO-3 '-IODODIPHENYL ETHER is an organic compound and should be used and stored correctly to avoid contact with flammable substances.
2. During use and operation, you should wear appropriate protective equipment, such as laboratory gloves and goggles, to prevent skin contact or splashing into the eyes.
3. Treat and dispose of waste in accordance with local regulations.
4. When storing, it should be stored in a closed container to avoid prolonged exposure to the air.
5. If the incorrect handling and use may cause danger, should be operated in a laboratory environment.
Nature:
1. Appearance: 4-FLUORO-3 '-IODODIPHENYL ETHER is a colorless crystalline solid.
2. Melting Point: about 57-59 degrees Celsius.
3. Boiling point: About 290-300 degrees Celsius.
4. High stability at room temperature.
5. Insoluble in water, better solubility in organic solvents.
Use:
1. Intermediate: 4-FLUORO-3 '-IODODIPHENYL ETHER can be used as an intermediate in organic synthesis reactions for the synthesis of other organic compounds.
2. Pharmaceutical field: It also has certain applications in some drug research and development fields.
Method:
4-FLUORO-3 '-IODODIPHENYL ETHER can be prepared by fluorination of phenol and iodobenzene in the presence of hydrofluoric acid. The specific steps are firstly adding phenol and iodobenzene into a reaction flask, reacting for a period of time after adding hydrofluoric acid, and then extracting and purifying.
Safety Information:
1. 4-FLUORO-3 '-IODODIPHENYL ETHER is an organic compound and should be used and stored correctly to avoid contact with flammable substances.
2. During use and operation, you should wear appropriate protective equipment, such as laboratory gloves and goggles, to prevent skin contact or splashing into the eyes.
3. Treat and dispose of waste in accordance with local regulations.
4. When storing, it should be stored in a closed container to avoid prolonged exposure to the air.
5. If the incorrect handling and use may cause danger, should be operated in a laboratory environment.
Last Update：2024-04-09 02:00:43
