1-(isocyanatomethyl)-4-methoxybenzene
4-Methoxybenzyl isocyanate
CAS: 56651-60-6
Molecular Formula: C9H9NO2
1-(isocyanatomethyl)-4-methoxybenzene - Names and Identifiers
| Name | 4-Methoxybenzyl isocyanate |
| Synonyms | 4-methoxybenyl isocyanate 4-Methoxybenzyl isocyanate p-Methoxybenzyl isocyanate 4-METHOXYBENZYL ISOCYANATE Isocyanic acid, p-methoxybenzyl- 1-(isocyanatomethyl)-4-methoxybenzene 1-(Isocyanatomethyl)-4-methoxybenzene, 4-(Isocyanatomethyl)phenyl methyl ether, 4-(Isocyanatomethyl)anisole |
| CAS | 56651-60-6 |
| InChI | InChI=1/C9H9NO2/c1-12-9-4-2-8(3-5-9)6-10-7-11/h2-5H,6H2,1H3 |
1-(isocyanatomethyl)-4-methoxybenzene - Physico-chemical Properties
| Molecular Formula | C9H9NO2 |
| Molar Mass | 163.17 |
| Density | 1.143 g/mL at 25 °C (lit.) |
| Boling Point | 60-66 °C/0.6 mmHg (lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.0223mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.433(lit.) |
1-(isocyanatomethyl)-4-methoxybenzene - Risk and Safety
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. R42 - May cause sensitization by inhalation |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | UN 2206PSN1B 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 29291090 |
| Hazard Class | IRRITANT |
1-(isocyanatomethyl)-4-methoxybenzene - Introduction
4-Methoxybenzyl isocyanate, referred to as 4-Methoxybenzyl isocyanate, the chemical formula is C9H9NO2. It is an organic compound with the following properties:
1. appearance: colorless or light yellow liquid.
2. odor: a pungent smell.
3. density: 1.105g/cm³.
4. Boiling point: 132-134°C.
5. Melting point:-21°C.
6. Solubility: Soluble in organic solvents such as benzene and dichloromethane.
4-Methoxybenzyl isocyanate has some important uses. It is often used as a chemical reagent in organic synthesis. Its typical applications include:
1. Used as an intermediate for the synthesis of organic compounds.
2. for the preparation of polymers and resins containing isocyanate functional groups.
3. in drug research for the synthesis of drug molecules.
4-Methoxybenzyl isocyanate can be prepared by the following methods:
the reaction of methoxy benzylamine with hydrocyanic acid ester in dichloromethane, then adding sodium bicarbonate for acid-base neutralization, using extractant to extract the product from the mixture, and then performing distillation purification to obtain the pure product.
When using 4-Methoxybenzyl isocyanate, you need to pay attention to the following safety information:
1. Irritation: This compound can cause irritation to the eyes, skin and respiratory tract. Therefore, it is necessary to wear appropriate personal protective equipment, such as gloves, goggles and protective masks during use.
2. Flammability: The compound is a combustible substance and should be kept away from open flames and high temperatures.
3. Storage: It should be stored in a closed container, away from fire and oxidant, to avoid reaction with other chemicals.
4. Waste Disposal: Waste shall be disposed of in accordance with local regulations and shall not be discharged into water sources or the environment.
1. appearance: colorless or light yellow liquid.
2. odor: a pungent smell.
3. density: 1.105g/cm³.
4. Boiling point: 132-134°C.
5. Melting point:-21°C.
6. Solubility: Soluble in organic solvents such as benzene and dichloromethane.
4-Methoxybenzyl isocyanate has some important uses. It is often used as a chemical reagent in organic synthesis. Its typical applications include:
1. Used as an intermediate for the synthesis of organic compounds.
2. for the preparation of polymers and resins containing isocyanate functional groups.
3. in drug research for the synthesis of drug molecules.
4-Methoxybenzyl isocyanate can be prepared by the following methods:
the reaction of methoxy benzylamine with hydrocyanic acid ester in dichloromethane, then adding sodium bicarbonate for acid-base neutralization, using extractant to extract the product from the mixture, and then performing distillation purification to obtain the pure product.
When using 4-Methoxybenzyl isocyanate, you need to pay attention to the following safety information:
1. Irritation: This compound can cause irritation to the eyes, skin and respiratory tract. Therefore, it is necessary to wear appropriate personal protective equipment, such as gloves, goggles and protective masks during use.
2. Flammability: The compound is a combustible substance and should be kept away from open flames and high temperatures.
3. Storage: It should be stored in a closed container, away from fire and oxidant, to avoid reaction with other chemicals.
4. Waste Disposal: Waste shall be disposed of in accordance with local regulations and shall not be discharged into water sources or the environment.
Last Update：2024-04-09 20:48:19
Supplier List
Product Name: 4-Methoxybenzyl Isocyanate Visit Supplier Webpage Request for quotation
CAS: 56651-60-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 56651-60-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 4-Methoxybenzyl Isocyanate Visit Supplier Webpage Request for quotation
CAS: 56651-60-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 56651-60-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History