1-Adamantyl-carboxamide
Adamantane-1-carboxamide
CAS: 5511-18-2
Molecular Formula: C11H17NO
1-Adamantyl-carboxamide - Names and Identifiers
| Name | Adamantane-1-carboxamide |
| Synonyms | SALOR-INT L496057-1EA OTAVA-BB BB5030040657 LABOTEST-BB LT00007835 1-Adamantyl-carboxamide 1-Adamantanecarboxamide Adamantane-1-carboxamide Tricyclo(3.3.1.13,7)decane-1-carboxamide tricyclo(3.3.1.1(sup3,7))decane-1-carboxamide Tricyclo(3.3.1.1(sup 3,7))decane-1-carboxamide (9CI) 2-Carbamoyladamantane, Tricyclo[3.3.1.1~3,7~]decane-1-carboxamide |
| CAS | 5511-18-2 |
| EINECS | 640-514-8 |
| InChI | InChI=1/C11H17NO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H2,12,13) |
1-Adamantyl-carboxamide - Physico-chemical Properties
| Molecular Formula | C11H17NO |
| Molar Mass | 179.26 |
| Density | 1.0020 (rough estimate) |
| Melting Point | 188-190°C(lit.) |
| Boling Point | 311.8°C (rough estimate) |
| Flash Point | 161.4°C |
| Solubility | Chloroform, Dichloromethane, Methanol |
| Vapor Presure | 7.09E-05mmHg at 25°C |
| Appearance | Solid |
| Color | White |
| BRN | 2047887 |
| pKa | 16.85±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5065 (estimate) |
| MDL | MFCD00077200 |
1-Adamantyl-carboxamide - Risk and Safety
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | AU4452000 |
| HS Code | 29242990 |
| Hazard Class | IRRITANT |
1-Adamantyl-carboxamide - Introduction
Adamantane-1-carboxamide is an organic compound whose chemical formula is C12H15NO. The following is a description of its nature, use, preparation and safety information:
Nature:
-Appearance: Adamantane-1-carboxamide is an organic solid, the common form is white crystalline powder.
-Melting point: Its melting point is about 212-216°C.
-solubility: in common organic solvents (such as ethanol, ether, dichloromethane, etc.) can be dissolved.
Use:
-Research purpose: Adamantane-1-carboxamide is a commonly used organic synthesis intermediate, which can be used to synthesize other organic compounds.
-Pharmaceutical Uses: No specific pharmaceutical uses have been identified for Adamantane-1-carboxamide.
Preparation Method:
- Adamantane-1-carboxamide is usually prepared by amination reaction, the specific steps are as follows:
1. In a suitable solvent, 1-adamantyl bromide reacts with ammonia to generate 1-adamantyl amine.
2. Under alkaline conditions, 1-adamantyl amine reacts with dimethyl carbonate to generate 1-adamantyl carboxylic acid methyl ester.
3. hydrolyze 1-adamantyl carboxylic acid methyl ester under acidic conditions to generate 1-adamantyl carboxylic acid.
4. Finally, 1-adamantylcarboxylic acid is reacted with a suitable acylating reagent to obtain Adamantane-1-carboxamide.
Safety Information:
- Adamantane-1-carboxamide are not dangerous under normal conditions.
-However, as an organic compound, exposure is subject to common laboratory safety practices, including the wearing of appropriate personal protective equipment (e. g., lab gloves, goggles, etc.).
-When performing synthesis or operation, proper ventilation conditions should be followed to ensure safety.
The above is only a general introduction. In specific cases, it is necessary to refer to the specific guidance of relevant laboratories or production operations.
Nature:
-Appearance: Adamantane-1-carboxamide is an organic solid, the common form is white crystalline powder.
-Melting point: Its melting point is about 212-216°C.
-solubility: in common organic solvents (such as ethanol, ether, dichloromethane, etc.) can be dissolved.
Use:
-Research purpose: Adamantane-1-carboxamide is a commonly used organic synthesis intermediate, which can be used to synthesize other organic compounds.
-Pharmaceutical Uses: No specific pharmaceutical uses have been identified for Adamantane-1-carboxamide.
Preparation Method:
- Adamantane-1-carboxamide is usually prepared by amination reaction, the specific steps are as follows:
1. In a suitable solvent, 1-adamantyl bromide reacts with ammonia to generate 1-adamantyl amine.
2. Under alkaline conditions, 1-adamantyl amine reacts with dimethyl carbonate to generate 1-adamantyl carboxylic acid methyl ester.
3. hydrolyze 1-adamantyl carboxylic acid methyl ester under acidic conditions to generate 1-adamantyl carboxylic acid.
4. Finally, 1-adamantylcarboxylic acid is reacted with a suitable acylating reagent to obtain Adamantane-1-carboxamide.
Safety Information:
- Adamantane-1-carboxamide are not dangerous under normal conditions.
-However, as an organic compound, exposure is subject to common laboratory safety practices, including the wearing of appropriate personal protective equipment (e. g., lab gloves, goggles, etc.).
-When performing synthesis or operation, proper ventilation conditions should be followed to ensure safety.
The above is only a general introduction. In specific cases, it is necessary to refer to the specific guidance of relevant laboratories or production operations.
Last Update：2024-04-09 21:00:56
Supplier List
Product Name: Adamantane-1-Carboxamide Visit Supplier Webpage Request for quotation
CAS: 5511-18-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 5511-18-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Adamantane-1-Carboxamide Visit Supplier Webpage Request for quotation
CAS: 5511-18-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 5511-18-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History