1-BENZOYL-4-PHENYL-3-THIOSEMICARBAZIDE
2-benzoyl-N-phenylhydrazinecarbothioamide
CAS: 13153-01-0
Molecular Formula: C14H13N3OS
1-BENZOYL-4-PHENYL-3-THIOSEMICARBAZIDE - Names and Identifiers
| Name | 2-benzoyl-N-phenylhydrazinecarbothioamide |
| Synonyms | 1-BENZOYL-4-PHENYL-3-THIOSEMICARBAZIDE 2-benzoyl-N-phenylhydrazinecarbothioamide 2-benzoyl-N-phenylhydrazine-1-carbothioamide Benzoic acid, 2-[(phenylamino)thioxomethyl]hydrazide |
| CAS | 13153-01-0 |
| InChI | InChI=1/C14H13N3OS/c18-13(11-7-3-1-4-8-11)16-17-14(19)15-12-9-5-2-6-10-12/h1-10H,(H,16,18)(H2,15,17,19) |
1-BENZOYL-4-PHENYL-3-THIOSEMICARBAZIDE - Physico-chemical Properties
| Molecular Formula | C14H13N3OS |
| Molar Mass | 271.34 |
| Density | 1.308g/cm3 |
| Refractive Index | 1.697 |
1-BENZOYL-4-PHENYL-3-THIOSEMICARBAZIDE - Introduction
1-Benzoyl-4-phenyl-3-thiosemicarbazide is an organic compound, also known as BPTU. Its chemical formula is C13H11N3S, with benzoyl, phenyl and thiosemicarbazide groups.
The compound has the following properties:
1. Appearance: colorless to light yellow crystal or crystalline powder;
2. Solubility: Soluble in common organic solvents, such as dimethyl sulfoxide, dimethyl formamide, etc.
Primary Use:
1. Pesticide: 1-benzoyl -4-phenyl -3-thiosemicarbazide has insecticidal activity and can be used in the agricultural field as an insecticide;
2. chemical synthesis: can be used as organic synthesis intermediates for the preparation of other compounds, such as drugs and dyes.
Preparation Method:
The synthesis method of 1-benzoyl -4-phenyl -3-thiosemicarbazide is more complicated and is usually obtained through a multi-step reaction. One of the commonly used synthetic routes is to heat the reaction of amino benzoyl formate and phenyl isothiocyanate under alkaline conditions to obtain the target product.
Safety Information:
1. 1-Benzoyl-4-phenyl-3-thiosemicarbazide is relatively stable in solid form, but may decompose or oxidize into harmful substances in the air;
2. Irritating to eyes, skin and respiratory system, rinse with plenty of water immediately after contact;
3. in use or storage should pay attention to prevent the generation of fire and static electricity;
4. Wear appropriate personal protective equipment such as gloves and safety glasses during operation.
The compound has the following properties:
1. Appearance: colorless to light yellow crystal or crystalline powder;
2. Solubility: Soluble in common organic solvents, such as dimethyl sulfoxide, dimethyl formamide, etc.
Primary Use:
1. Pesticide: 1-benzoyl -4-phenyl -3-thiosemicarbazide has insecticidal activity and can be used in the agricultural field as an insecticide;
2. chemical synthesis: can be used as organic synthesis intermediates for the preparation of other compounds, such as drugs and dyes.
Preparation Method:
The synthesis method of 1-benzoyl -4-phenyl -3-thiosemicarbazide is more complicated and is usually obtained through a multi-step reaction. One of the commonly used synthetic routes is to heat the reaction of amino benzoyl formate and phenyl isothiocyanate under alkaline conditions to obtain the target product.
Safety Information:
1. 1-Benzoyl-4-phenyl-3-thiosemicarbazide is relatively stable in solid form, but may decompose or oxidize into harmful substances in the air;
2. Irritating to eyes, skin and respiratory system, rinse with plenty of water immediately after contact;
3. in use or storage should pay attention to prevent the generation of fire and static electricity;
4. Wear appropriate personal protective equipment such as gloves and safety glasses during operation.
Last Update：2024-04-09 02:00:41
