1-Bromo-2,6-difluoro
1-bromo-2,6-difluorobenzene
CAS: 64248-56-2
Molecular Formula: C6H3BrF2
1-Bromo-2,6-difluoro - Names and Identifiers
| Name | 1-bromo-2,6-difluorobenzene |
| Synonyms | 1-Bromo-2,6-difluoro 2,6-Difluorobromobenzene 2,6-DIFLUOROBROMOBENZENE 2,6-Difluorophenyl Bromide 1,3-Difluoro-2-Bromobenzene 1-BROMO-2,6-DIFLUOROBENZENE 2-BROMO-1,3-DIFLUOROBENZENE 2-Bromo-1,3-Difluorobenzene 1-bromo-2,6-difluorobenzene Benzene,2-bromo-1,3-difluoro- Benzene,2-Bromo-1,3-Difluoro- 2,6-Difluorobromobenzene2-Bromo-1,3-difluorobenzene |
| CAS | 64248-56-2 |
| EINECS | 264-750-2 |
| InChI | InChI=1/C6H3F2I/c7-5-2-1-4(9)3-6(5)8/h1-3H |
| InChIKey | HRZTZLCMURHWFY-UHFFFAOYSA-N |
1-Bromo-2,6-difluoro - Physico-chemical Properties
| Molecular Formula | C6H3BrF2 |
| Molar Mass | 192.99 |
| Density | 1.71 |
| Melting Point | 20 °C |
| Boling Point | 61 °C (35 mmHg) |
| Flash Point | 128°F |
| Vapor Presure | 1.05mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear yellow |
| BRN | 1681053 |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | n20/D 1.51(lit.) |
| Physical and Chemical Properties | Yellow liquid. The boiling point is 61 ° C, the flash point is 53 ° C, the refractive index is 1.5100, and the specific gravity is 1.71. |
1-Bromo-2,6-difluoro - Risk and Safety
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 29039990 |
| Hazard Note | Flammable |
| Hazard Class | 3 |
| Packing Group | III |
1-Bromo-2,6-difluoro - Reference Information
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Use | Pharmaceutical, pesticide, liquid crystal material intermediates. |
Last Update：2024-04-09 20:52:54
