1-Bromo-3-chloro-4-methoxybenzene

1-Bromo-3-chloro-4-methoxybenzene - Names and Identifiers

Name	4-bromo-2-chloroanisole
Synonyms	Chloro-4-bromoanisole 4-bromo-2-chloroanisole 2-Chloro-4-bromoanisole 4-BROMO-2-CHLOROANISOLE 3-Chloro-4-methoxyphenyl bromide 4-bromo-2-chloro-1-methoxybenzene 1-Bromo-3-chloro-4-methoxybenzene 2-chloro-4-Bromo-1-methoxy-benzene Benzene,4-bromo-2-chloro-1-methoxy- Methyl(2-chloro-4-bromophenyl) ether
CAS	50638-47-6
EINECS	256-672-2
InChI	InChI=1/C7H6BrClO/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3

1-Bromo-3-chloro-4-methoxybenzene - Physico-chemical Properties

Molecular Formula	C7H6BrClO
Molar Mass	221.48
Density	1.564
Melting Point	68.5-70.5°C
Boling Point	242℃
Flash Point	100℃
Vapor Presure	0.0538mmHg at 25°C
Storage Condition	Sealed in dry,Room Temperature
Refractive Index	1.556

1-Bromo-3-chloro-4-methoxybenzene - Introduction

4-bromo-2-chrooanisole (4-bromo-2-chrooanisole) is an organic compound with the chemical formula C7H6BrClO.

Its main properties are as follows:
1. Appearance: colorless to light yellow solid.
2. solubility: soluble in organic solvents, such as alcohols and ethers.
3. melting point: about 37-39 ℃.
4. Boiling point: about 209-210 ℃.

The main uses of this compound include:
1. as an organic synthesis intermediate for the synthesis of other compounds.
2. in the field of medicine, can be used for the synthesis of certain drugs raw materials.

The method of preparing 4-bromo-2-chloroanisole generally comprises the following steps:
1. 2-chloroanisole and sodium nitrite are reacted to obtain p-nitroanisole.
2. p-nitroanisole reacts with cuprous chloride to obtain p-methoxyanisole.
3. Finally, p-methoxyanisole is reacted with bromine to give 4-bromo-2-chloroanisole.

Regarding safety information, 4-bromo-2-chloroanisole is an organic compound and the following precautions should be observed:
1. Avoid contact with skin, eyes and mucous membranes. In case of accidental contact, rinse immediately with plenty of water for 15 minutes and seek medical help.
2. when in use, should comply with protective measures, such as wearing protective glasses, gloves and protective clothing.
3. Store away from fire and heat sources, keep sealed, and place in a well-ventilated place.

Last Update：2024-04-09 21:00:56