1-Ferrocenyl-3-phenyl-1-propenone
1-Ferrocenyl-3-phenyl-1-propenone
CAS: 1292-30-4
Molecular Formula: C19H8FeO-10
1-Ferrocenyl-3-phenyl-1-propenone - Names and Identifiers
| Name | 1-Ferrocenyl-3-phenyl-1-propenone |
| Synonyms | Nsc346195 1-Ferrocenyl-3-phenyl-1-propenone Ferrocene,(1-oxo-3-phenyl-2-propen-1-yl)- |
| CAS | 1292-30-4 |
| InChI | InChI=1S/C14H7O.C5H.Fe/c15-14(13-8-4-5-9-13)11-10-12-6-2-1-3-7-12;1-2-4-5-3-1;/h1-3,6-7,10-11H;1H;/q2*-5;/b11-10+; |
1-Ferrocenyl-3-phenyl-1-propenone - Physico-chemical Properties
| Molecular Formula | C19H8FeO-10 |
| Molar Mass | 308.11122 |
| Boling Point | 350.1°C at 760 mmHg |
| Flash Point | 152.8°C |
| Vapor Presure | 4.51E-05mmHg at 25°C |
1-Ferrocenyl-3-phenyl-1-propenone - Introduction
Ferrocenyl styryl ketone is an organic substance with the molecular formula C16H12FeO. It is a compound synthesized by the reaction of ferrocene with styrene ketone.
Ferrocenyl styryl ketone has the following properties:
1. the appearance of deep red crystals, can be dissolved in some organic solvents such as ether and acetone.
2. has a strong ability to absorb UV-Vis spectra.
3. It has reversible redox properties and can be converted between different oxidation states.
Ferrocenyl styryl ketones are widely used in organic synthesis, catalytic reactions and materials science, and have the following main uses:
1. As a catalyst to participate in asymmetric catalytic reactions, catalysts are usually used to improve the reaction rate, selectivity and yield.
2. As an optical material, it has application potential in the fields of optoelectronics and light-emitting diodes.
3. As a component of the electron conductive polymer material, it can be used to prepare electronic devices.
The preparation method of ferrocenyl styryl ketone includes the reaction of ferrocene and styryl ketone in the presence of alcohol and base.
Regarding safety information, ferrocenyl styryl ketone needs to be handled in accordance with general laboratory safety practices to avoid contact with skin, eyes and respiratory tract. When stored and disposed of, it shall be disposed of in accordance with relevant laws and regulations. Specific safety information and protective measures should refer to the safety data sheet (SDS) of the chemical and related literature.
Ferrocenyl styryl ketone has the following properties:
1. the appearance of deep red crystals, can be dissolved in some organic solvents such as ether and acetone.
2. has a strong ability to absorb UV-Vis spectra.
3. It has reversible redox properties and can be converted between different oxidation states.
Ferrocenyl styryl ketones are widely used in organic synthesis, catalytic reactions and materials science, and have the following main uses:
1. As a catalyst to participate in asymmetric catalytic reactions, catalysts are usually used to improve the reaction rate, selectivity and yield.
2. As an optical material, it has application potential in the fields of optoelectronics and light-emitting diodes.
3. As a component of the electron conductive polymer material, it can be used to prepare electronic devices.
The preparation method of ferrocenyl styryl ketone includes the reaction of ferrocene and styryl ketone in the presence of alcohol and base.
Regarding safety information, ferrocenyl styryl ketone needs to be handled in accordance with general laboratory safety practices to avoid contact with skin, eyes and respiratory tract. When stored and disposed of, it shall be disposed of in accordance with relevant laws and regulations. Specific safety information and protective measures should refer to the safety data sheet (SDS) of the chemical and related literature.
Last Update：2024-04-10 22:29:15
