1-Methylbutylamine
Sec-amylamine
CAS: 625-30-9;63493-28-7
Molecular Formula: C5H13N
1-Methylbutylamine - Names and Identifiers
| Name | Sec-amylamine |
| Synonyms | 2-AMYLAMINE Aminopentane Sec-amylamine 2-Pentanamine sec-Amylamine 2-Aminopentane 2-AMINOPENTANE 2-Methylbutylamine 1-Methylbutylamine 1-METHYLBUTYLAMINE (2S)-pentan-2-amine RARECHEM AN KC 0232 Butylamine, 1-methyl- 1-Methyl-1-butanamine 1-Methyl-n-butylamine alpha-Methylbutylamine |
| CAS | 625-30-9 63493-28-7 |
| EINECS | 210-886-2 |
| InChI | InChI=1/C5H13N/c1-3-4-5(2)6/h5H,3-4,6H2,1-2H3/t5-/m0/s1 |
1-Methylbutylamine - Physico-chemical Properties
| Molecular Formula | C5H13N |
| Molar Mass | 87.16 |
| Density | 0.736g/mLat 25°C(lit.) |
| Melting Point | -70°C (estimate) |
| Boling Point | 90.5-91.5°C(lit.) |
| Flash Point | 95°F |
| Vapor Presure | 51.1mmHg at 25°C |
| Refractive Index | n20/D 1.4020(lit.) |
1-Methylbutylamine - Risk and Safety
| Hazard Symbols | C - Corrosive |
| Risk Codes | R10 - Flammable R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 1106 3/PG 3 |
| WGK Germany | 3 |
| Hazard Class | 8 |
| Packing Group | II |
1-Methylbutylamine - Introduction
Sec-amylamine is an organic compound with the chemical formula C5H11NH2. It is a colorless liquid with a pungent odor. The following is a detailed description of the nature, use, preparation and safety information of the Sec-amylamine:
Nature:
1. appearance: colorless liquid.
2. density: about 0.77g/cm3.
3. Boiling point: about 110-112°C.
4. Melting point: about -16°C.
5. Solubility: Soluble in water and organic solvents, such as ethanol and ether.
Use:
1. As an intermediate in organic synthesis, it is used to prepare other compounds, such as polyamide resins, surfactants, etc.
2. As a component of buffer and catalyst in some chemical reactions.
3. for the preparation of pesticides, pharmaceuticals and dyes.
Preparation Method:
A common preparation method of Sec-amylamine is obtained by the reaction of pentane with ammonia gas. Specific steps are as follows:
1. mix pentane and dichloromethane in proportion.
2. Add the mixture to the reaction vessel and add ammonia gas.
3. The reaction is carried out at an appropriate temperature and pressure.
4. Filtration, distillation and purification of the product to obtain high purity Sec-amylamine.
Safety Information:
1. Sec-amylamine is irritating and may cause irritation to the eyes, skin and respiratory tract.
2. use need to avoid direct contact with the skin and eyes, if necessary, wear protective glasses and gloves.
3. in use or storage, should be away from the fire and high temperature, to ensure adequate ventilation.
4. If accidental ingestion or exposure occurs, rinse immediately with water and seek medical advice.
5. In any experiment or application, the relevant safety procedures and regulations should be carefully followed.
Please note that the nature and safety information of chemicals are correctly understood, and correct operation methods and protective measures are followed to ensure safe use.
Nature:
1. appearance: colorless liquid.
2. density: about 0.77g/cm3.
3. Boiling point: about 110-112°C.
4. Melting point: about -16°C.
5. Solubility: Soluble in water and organic solvents, such as ethanol and ether.
Use:
1. As an intermediate in organic synthesis, it is used to prepare other compounds, such as polyamide resins, surfactants, etc.
2. As a component of buffer and catalyst in some chemical reactions.
3. for the preparation of pesticides, pharmaceuticals and dyes.
Preparation Method:
A common preparation method of Sec-amylamine is obtained by the reaction of pentane with ammonia gas. Specific steps are as follows:
1. mix pentane and dichloromethane in proportion.
2. Add the mixture to the reaction vessel and add ammonia gas.
3. The reaction is carried out at an appropriate temperature and pressure.
4. Filtration, distillation and purification of the product to obtain high purity Sec-amylamine.
Safety Information:
1. Sec-amylamine is irritating and may cause irritation to the eyes, skin and respiratory tract.
2. use need to avoid direct contact with the skin and eyes, if necessary, wear protective glasses and gloves.
3. in use or storage, should be away from the fire and high temperature, to ensure adequate ventilation.
4. If accidental ingestion or exposure occurs, rinse immediately with water and seek medical advice.
5. In any experiment or application, the relevant safety procedures and regulations should be carefully followed.
Please note that the nature and safety information of chemicals are correctly understood, and correct operation methods and protective measures are followed to ensure safe use.
Last Update：2024-04-09 15:17:58
Supplier List
Product Name: Sec-amylamine Request for quotation
CAS: 63493-28-7
Tel: 0086-551-65418684
Email: sales@tnjchem.com
info@tnjchem.com
Mobile: 0086 189 4982 3763
QQ: 2881500840
Wechat: 0086 189 4982 3763
WhatsApp: 0086 189 4982 3763
Product List: View Catalog
CAS: 63493-28-7
Tel: 0086-551-65418684
Email: sales@tnjchem.com
info@tnjchem.com
Mobile: 0086 189 4982 3763
QQ: 2881500840
Wechat: 0086 189 4982 3763
WhatsApp: 0086 189 4982 3763
Product List: View Catalog
Product Name: Sec-amylamine Request for quotation
CAS: 63493-28-7
Tel: 0086-551-65418684
Email: sales@tnjchem.com
info@tnjchem.com
Mobile: 0086 189 4982 3763
QQ: 2881500840
Wechat: 0086 189 4982 3763
WhatsApp: 0086 189 4982 3763
Product List: View Catalog
CAS: 63493-28-7
Tel: 0086-551-65418684
Email: sales@tnjchem.com
info@tnjchem.com
Mobile: 0086 189 4982 3763
QQ: 2881500840
Wechat: 0086 189 4982 3763
WhatsApp: 0086 189 4982 3763
Product List: View Catalog
View History