1-PHENYLPYRAZOL-4-AMINE

1-PHENYLPYRAZOL-4-AMINE - Names and Identifiers

Name	1-phenyl-1H-pyrazol-4-amine
Synonyms	1-PHENYLPYRAZOL-4-AMINE 1-Phenyl-1H-pyrazol-4-amine 1-phenyl-1H-pyrazol-4-amine 4-Amino-1-phenyl-1H-pyrazole 1H-Pyrazol-4-amine, 1-phenyl- 1-Phenyl-1H-pyrazol-4-ylamine 1H-pyrazol-4-amine, 1-phenyl-
CAS	1128-53-6
InChI	InChI=1/C9H9N3/c10-8-6-11-12(7-8)9-4-2-1-3-5-9/h1-7H,10H2

1-PHENYLPYRAZOL-4-AMINE - Physico-chemical Properties

Molecular Formula	C9H9N3
Molar Mass	159.19
Density	1.20±0.1 g/cm3(Predicted)
Melting Point	104-105 °C(Solv: ligroine (8032-32-4))
Boling Point	305.4±15.0 °C(Predicted)
Flash Point	138.5°C
Vapor Presure	0.000822mmHg at 25°C
pKa	4.45±0.10(Predicted)
Storage Condition	Room Temprature
Refractive Index	1.641

1-PHENYLPYRAZOL-4-AMINE - Introduction

1-Phenyl -4-amine -1H-pyrazole, commonly known as PAPI, is an organic compound. Its molecular formula is C12H10N2 and its molecular weight is 182.22.

Properties of PAPI:
1. Appearance: White crystalline solid.
2. melting point: 101-103 ℃.
3. Boiling point: 316 ℃.
4. Stability: PAPI is a stable compound, which will not produce obvious changes to most common chemicals at room temperature.

Purpose of PAPI:
1. raw materials: PAPI is an important intermediate in the production of polyurethane, polyurethane used as a cross-linking agent.
2. Adhesive: PAPI can be used to produce high-performance adhesives, such as structural adhesives, sealants, etc.
3. Resin: PAPI can be used to produce high-performance light-curing resins, such as UV-curing resins.
4. Coatings: PAPI can be used to produce high-performance coatings, such as vehicle coatings, industrial coatings, etc.

Preparation of PAPI:
The preparation method of PAPI is mainly synthesized by substitution reaction. The specific method is to react aniline with halogenated pyrazole, and under appropriate conditions, make it undergo substitution reaction to generate 1-phenyl -4-amine -1H-pyrazole.

Security information for PAPI:
1. PAPI has a stimulating effect on the skin and eyes. Wear protective glasses and gloves during operation.
2. Avoid inhaling PAPI dust. If dust is generated, appropriate measures should be taken, such as wearing a mask or using ventilation equipment.
3. PAPI should be stored in a dry, well-ventilated place, away from fire and flammable materials.
4. PAPI is a hazardous chemical and must be used in accordance with relevant safety procedures and stored, transported and handled in accordance with local regulations.
5. When using or handling PAPI, you must strictly follow the relevant safety operation guidelines to reduce risks and protect your own safety.

Last Update：2024-04-10 22:29:15