1-pyrrolidinecarboxylic acid, 2-(aminocarbonyl)-, phenylmethyl ester
benzyl 2-carbamoylpyrrolidine-1-carboxylate
CAS: 93188-01-3
Molecular Formula: C13H16N2O3
1-pyrrolidinecarboxylic acid, 2-(aminocarbonyl)-, phenylmethyl ester - Names and Identifiers
| Name | benzyl 2-carbamoylpyrrolidine-1-carboxylate |
| Synonyms | Cbz-DL-prolinamide Cbz-DL-prolinaMide BENZYL 2-CARBAMOYLPYRROLIDINE-1-CARBOXYLATE benzyl 2-carbamoylpyrrolidine-1-carboxylate 1-pyrrolidinecarboxylic acid, 2-(aminocarbonyl)-, phenylmethyl ester |
| CAS | 93188-01-3 |
| InChI | InChI=1/C13H16N2O3/c14-12(16)11-7-4-8-15(11)13(17)18-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H2,14,16) |
1-pyrrolidinecarboxylic acid, 2-(aminocarbonyl)-, phenylmethyl ester - Physico-chemical Properties
| Molecular Formula | C13H16N2O3 |
| Molar Mass | 248.28 |
| Density | 1.263 |
| Boling Point | 465.6°C at 760 mmHg |
| Flash Point | 235.4°C |
| Vapor Presure | 7.61E-09mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.581 |
1-pyrrolidinecarboxylic acid, 2-(aminocarbonyl)-, phenylmethyl ester - Introduction
Benzyl, whose chemical name is benzyl -2-carbamoyl pyrrolidine-1-carboxylate, is a commonly used protecting group in organic synthesis. It has the following properties:
1. Appearance: White crystalline solid.
2. Solubility: Good solubility in common organic solvents, such as methanol, ethanol, dichloromethane, etc.
3. melting point: about 140-142 ℃.
4. use: benzyl is commonly used in organic chemistry to protect the amino reaction, can protect the amino group to prevent unnecessary side reactions in the reaction process.
5. preparation method: benzyl is generally prepared by reacting benzylamine with benzylchloroformate to generate the target product under the catalysis of alkali. After the reaction, the pure product can be obtained by crystallization and purification.
6. safety information: benzyl is relatively stable under general conditions, but should avoid prolonged contact with skin and eyes. Pay attention to personal protective measures during use and comply with the regulations on handling and storage of dangerous goods.
1. Appearance: White crystalline solid.
2. Solubility: Good solubility in common organic solvents, such as methanol, ethanol, dichloromethane, etc.
3. melting point: about 140-142 ℃.
4. use: benzyl is commonly used in organic chemistry to protect the amino reaction, can protect the amino group to prevent unnecessary side reactions in the reaction process.
5. preparation method: benzyl is generally prepared by reacting benzylamine with benzylchloroformate to generate the target product under the catalysis of alkali. After the reaction, the pure product can be obtained by crystallization and purification.
6. safety information: benzyl is relatively stable under general conditions, but should avoid prolonged contact with skin and eyes. Pay attention to personal protective measures during use and comply with the regulations on handling and storage of dangerous goods.
Last Update：2024-04-09 18:58:34
Supplier List
Product Name: BENZYL 2-CARBAMOYLPYRROLIDINE-1-CARBOXYLATE Visit Supplier Webpage Request for quotation
CAS: 93188-01-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 93188-01-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: BENZYL 2-CARBAMOYLPYRROLIDINE-1-CARBOXYLATE Visit Supplier Webpage Request for quotation
CAS: 93188-01-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 93188-01-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History