93188-01-3

93188-01-3 - Names and Identifiers

Name	benzyl 2-carbamoylpyrrolidine-1-carboxylate
Synonyms	Cbz-DL-prolinamide Cbz-DL-prolinaMide BENZYL 2-CARBAMOYLPYRROLIDINE-1-CARBOXYLATE benzyl 2-carbamoylpyrrolidine-1-carboxylate 1-pyrrolidinecarboxylic acid, 2-(aminocarbonyl)-, phenylmethyl ester
CAS	93188-01-3
InChI	InChI=1/C13H16N2O3/c14-12(16)11-7-4-8-15(11)13(17)18-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H2,14,16)

93188-01-3 - Physico-chemical Properties

Molecular Formula	C13H16N2O3
Molar Mass	248.28
Density	1.263
Boling Point	465.6°C at 760 mmHg
Flash Point	235.4°C
Vapor Presure	7.61E-09mmHg at 25°C
Storage Condition	2-8°C
Refractive Index	1.581

93188-01-3 - Introduction

Benzyl, whose chemical name is benzyl -2-carbamoyl pyrrolidine-1-carboxylate, is a commonly used protecting group in organic synthesis. It has the following properties:

1. Appearance: White crystalline solid.

2. Solubility: Good solubility in common organic solvents, such as methanol, ethanol, dichloromethane, etc.

3. melting point: about 140-142 ℃.

4. use: benzyl is commonly used in organic chemistry to protect the amino reaction, can protect the amino group to prevent unnecessary side reactions in the reaction process.

5. preparation method: benzyl is generally prepared by reacting benzylamine with benzylchloroformate to generate the target product under the catalysis of alkali. After the reaction, the pure product can be obtained by crystallization and purification.

6. safety information: benzyl is relatively stable under general conditions, but should avoid prolonged contact with skin and eyes. Pay attention to personal protective measures during use and comply with the regulations on handling and storage of dangerous goods.

Last Update：2024-04-09 18:58:34