1005631-56-0

1005631-56-0 - Names and Identifiers

Name	1-(2,2-diethoxyethyl)-4-methyl-1H-pyrazole
Synonyms	1-(2,2-ethoxyethyl)-4-methyl-1H-pyrazole 1-(2,2-diethoxyethyl)-4-methyl-1H-pyrazole 1H-Pyrazole, 1-(2,2-diethoxyethyl)-4-Methyl- 1H-Pyrazole, 1-(2,2-diethoxyethyl)-4-methyl-
CAS	1005631-56-0
InChI	InChI=1S/C10H18N2O2/c1-4-13-10(14-5-2)8-12-7-9(3)6-11-12/h6-7,10H,4-5,8H2,1-3H3

1005631-56-0 - Physico-chemical Properties

Molecular Formula	C10H18N2O2
Molar Mass	198.26
Boling Point	278℃
Storage Condition	2-8°C

1005631-56-0 - Introduction

Nature:
1-(2,2-ethoxyethyl) 4-methyl -1H-pyrazole is a colorless to pale yellow liquid. It has a faint smell of oil. The compound has a density of 0.98g/cm³ and a boiling point between 290°C and 300°C. It is soluble in alcohol, chloroform and other organic solvents, insoluble in water.

Use:
1-(2,2-ethoxyethyl) 4-methyl -1H-pyrazole can be used as an intermediate, widely used in organic synthesis. It is commonly used in the synthesis of various drugs, pesticides and dyes and other organic compounds.

Preparation Method:
The synthesis of 1-(2,2-ethoxyethyl) 4-methyl -1H-pyrazole can be carried out by the following steps:
1. The pyrazole is reacted with alkaline alcohol to generate the corresponding pyrazole acetal under appropriate temperature conditions.
2. Etherification reaction of pyrazole acetal with ethylene glycol to generate 1-(2,2-ethoxyethyl) pyrazole.
3. Finally, 1-(2,2-ethoxyethyl) pyrazole is reacted with a methylating reagent to generate the target product 1-(2,2-ethoxyethyl) 4-methyl -1H-pyrazole.

Safety Information:
1-(2,2-ethoxyethyl) 4-methyl-1H-pyrazole is generally relatively safe under routine operations, but basic safety precautions still need to be maintained:
1. use should wear appropriate personal protective equipment (such as gloves, goggles).
2. avoid contact with skin, such as contact with skin, should immediately wash with soap and water thoroughly.
3. Avoid inhaling its vapor and operate in a well-ventilated environment.
4. storage should be sealed, away from the fire and oxidant.

Last Update：2024-04-09 21:00:56